Index of /mystiek/astrology_research/adb_stats/Recente Geboorteakten
![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | (Romein-)Verschoor, ..> | 2025-12-10 20:09 | 121K | |
![[IMG]](/icons/image2.gif) | Aa, Jan van der 25-..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Aafjes, Sijtje Antje..> | 2025-12-10 20:09 | 93K | |
![[IMG]](/icons/image2.gif) | Aalbers, Albertus Fr..> | 2025-12-10 20:09 | 228K | |
![[IMG]](/icons/image2.gif) | Aalberse, Petrus Jos..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Aalberse, Petrus Jos..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Aalsmeer, William Ch..> | 2025-12-10 20:09 | 127K | |
![[IMG]](/icons/image2.gif) | Aalst, Cornelis Joha..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Aarden, Jacobus Mari..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Aarsse, Johanna van ..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Abeleven, Willem Alb..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Abendanon, Jacques H..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Aberson, Johannes He..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Abkoude, Christiaan ..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Abrahams, Anna Adela..> | 2025-12-10 20:09 | 172K | |
![[IMG]](/icons/image2.gif) | Achenbach, Christina..> | 2025-12-10 20:09 | 232K | |
![[IMG]](/icons/image2.gif) | Adama van Scheltema,..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Adama van Scheltema,..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Addens, Nanno Gerhar..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Adriani, Pieter Jako..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Aengenent, Johannes ..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Ailly, Arnold Jan d'..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Alban, Constant Jose..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Albarda, Johan Wille..> | 2025-12-10 20:09 | 292K | |
![[IMG]](/icons/image2.gif) | Alberdingk Thijm, J..> | 2025-12-10 20:09 | 239K | |
![[IMG]](/icons/image2.gif) | Alberdingk Thijm, Ka..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Alberga, Adriaan Cor..> | 2025-12-10 20:09 | 292K | |
![[IMG]](/icons/image2.gif) | Albers, Johan Hendri..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Albers, Willem 30 no..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Alberts, Jappe 18 Oc..> | 2025-12-10 20:09 | 245K | |
![[IMG]](/icons/image2.gif) | Alblas, Aart Hendrik..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Albregt, Christina M..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Aler, Izaak Alphonse..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Alfrink, Bernardus J..> | 2025-12-10 20:09 | 247K | |
![[IMG]](/icons/image2.gif) | Algra, Hendrik 5 Jan..> | 2025-12-10 20:09 | 244K | |
![[IMG]](/icons/image2.gif) | Aloserij, Wilhelmus ..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Alphen, François va..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Alsbach, Johann Adam..> | 2025-12-10 20:09 | 185K | |
![[IMG]](/icons/image2.gif) | Alt, Margaretha Adri..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Althoff, Adrianus Al..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Alvarez Correa, May,..> | 2025-12-10 20:09 | 227K | |
![[IMG]](/icons/image2.gif) | Amelink, Herman 21-1..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Ampt, Anna Adriana E..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Andel, Martinus Anto..> | 2025-12-10 20:09 | 184K | |
![[IMG]](/icons/image2.gif) | Andreae, Wabina 11 s..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Andriesse, Emmy Euge..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Andriessen, Johanna ..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Andriessen, Marie Si..> | 2025-12-10 20:09 | 183K | |
![[IMG]](/icons/image2.gif) | Andriessen, Pieter J..> | 2025-12-10 20:09 | 242K | |
![[IMG]](/icons/image2.gif) | Andriessen, Wilhelmu..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | André de la Porte, ..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Anema, Anne 10-2-187..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Anema, Seerp 31-10-1..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Angeren, Johannes Re..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Anker Hesselink, Lou..> | 2025-12-10 20:09 | 252K | |
![[IMG]](/icons/image2.gif) | Ankersmit, Gerharda ..> | 2025-12-10 20:09 | 142K | |
![[IMG]](/icons/image2.gif) | Anrooij, Peter Gijsb..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Ansingh, Theresia 9 ..> | 2025-12-10 20:09 | 131K | |
![[IMG]](/icons/image2.gif) | Anton van Gijn 17-9-..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Apeldoorn, Lambertus..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Apeldoorn, Lambertus..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Appel, Abraham Leona..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Appels, Johanna Adri..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Arend, Arie den , 3 ..> | 2025-12-10 20:09 | 185K | |
![[IMG]](/icons/image2.gif) | Arisz, Willem Hendri..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Ariëns, Alphonse Ma..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Arkel, Gerrit van 3 ..> | 2025-12-10 20:09 | 253K | |
![[IMG]](/icons/image2.gif) | Arntzenius, Péronn..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Arntzenius, Constanc..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Appeldoorn, Christin..> | 2025-12-10 20:09 | 103K | |
![[IMG]](/icons/image2.gif) | Arntzenius, Paul 20 ..> | 2025-12-10 20:09 | 185K | |
![[IMG]](/icons/image2.gif) | Arp, Elsina 26 Aug 1..> | 2025-12-10 20:09 | 248K | |
![[IMG]](/icons/image2.gif) | Arts, Susanne Sophia..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Asbeck, Agnes Mellin..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Asbeck, Frederik Mar..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Asch van Wijck, Corn..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Asscher, Abraham 19 ..> | 2025-12-10 20:09 | 256K | |
![[IMG]](/icons/image2.gif) | Asscher, Henriëtte ..> | 2025-12-10 20:09 | 114K | |
![[IMG]](/icons/image2.gif) | Asselbergs, Wilhelmu..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Assen, Jacobus van 1..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Asser, Carel Daniël..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Asser, Elias 22 dece..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Aten [sr.], Adriaan ..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Aten, Adriaan Hendri..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Aulnis de Bourouill,..> | 2025-12-10 20:09 | 316K | |
![[IMG]](/icons/image2.gif) | Aulnis de Bourouill,..> | 2025-12-10 20:09 | 246K | |
![[IMG]](/icons/image2.gif) | Averink, Hanna Jacob..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Averkamp, Antonius J..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Baale, Marie Jeanett..> | 2025-12-10 20:09 | 243K | |
![[IMG]](/icons/image2.gif) | Baanders, Harmanus H..> | 2025-12-10 20:09 | 236K | |
![[IMG]](/icons/image2.gif) | Baanders, Herman Amb..> | 2025-12-10 20:09 | 227K | |
![[IMG]](/icons/image2.gif) | Baanders, Jan 8 sept..> | 2025-12-10 20:09 | 77K | |
![[IMG]](/icons/image2.gif) | Baantjer, Albert Cor..> | 2025-12-10 20:09 | 196K | |
![[IMG]](/icons/image2.gif) | Baaren, Cornelis Lee..> | 2025-12-10 20:09 | 182K | |
![[IMG]](/icons/image2.gif) | Baart, Lucretia Jaco..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Baart, Maria Elize 2..> | 2025-12-10 20:09 | 248K | |
![[IMG]](/icons/image2.gif) | Baas Becking, Louren..> | 2025-12-10 20:09 | 184K | |
![[IMG]](/icons/image2.gif) | Backer, Hilmar Johan..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Bader, Wilhelmina Co..> | 2025-12-10 20:09 | 168K | |
![[IMG]](/icons/image2.gif) | Baelde, Robert 22 ju..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Baerends, Gerardus P..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Baeten, Joseph Wilhe..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Bake, Bertha Lina An..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Bakhuys Roozeboom, H..> | 2025-12-10 20:09 | 185K | |
![[IMG]](/icons/image2.gif) | Bakker, Hendrik de 2..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Bakker, Jantje Anna ..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Bakker, Rindert van ..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Balfoort, Dirk Jacob..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Balluseck, Daniël J..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Barend, David 13 mei..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Barendregt, Johan Te..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Barendse, Bernardus ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Barnard, Hendrik Joh..> | 2025-12-10 20:09 | 183K | |
![[IMG]](/icons/image2.gif) | Barnard, Wilhelmus 1..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Barnouw, Adriaan Jac..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Barrucand, Piternell..> | 2025-12-10 20:09 | 184K | |
![[IMG]](/icons/image2.gif) | Bartstra, Jan Steffe..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Bas, François de 10..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Basart, Henri Johan ..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Basenau, Annie Maria..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Baumeister, Geertrui..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Baumhauer, Albert Gi..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Bax, Johannes Stepha..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Bazel, Karel Petrus ..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Beaufort, Leo Joseph..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Becker, Johanna Mari..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Beckers, Hendrik Jos..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Beeck, Nicolaas Adri..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Beek, Johannes Alber..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Beek, Marinus Johann..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Beek, Martinus Adria..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Beekman, Anton Alber..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Beekum, Karl Jakob v..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Been, Johannes Hendr..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Beer Poortugael, Jac..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Beerman, Albert Chri..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Beernink, Hendrik Ka..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Beernink, Hendrikus ..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Beers, Hendrikus Cor..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Beijen, Hendrik Gera..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Beijen, Johan Willem..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Beijerinck, Martinus..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Bekkers, Wilhelmus M..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Belinfante, Emilie J..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Bemmel, Albertus Mar..> | 2025-12-10 20:09 | 173K | |
![[IMG]](/icons/image2.gif) | Bemmel, Albertus Mar..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Bemmelen, Jacob Maar..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Bemmelen, Jacob Maar..> | 2025-12-10 20:09 | 185K | |
![[IMG]](/icons/image2.gif) | Bemmelen, Johan Fran..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Bendien, Jacob 16 ap..> | 2025-12-10 20:09 | 184K | |
![[IMG]](/icons/image2.gif) | Benningshof, Hendrik..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Bens, Jan 15 april 1..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Bentinck van Schoonh..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Berenschot, Berend W..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Berg, Andries van de..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Berg, Christiaan Fre..> | 2025-12-10 20:09 | 184K | |
![[IMG]](/icons/image2.gif) | Berg, Franciscus van..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Berg, Norbertus Petr..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Bergen, Huerta Milan..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Bergh, Herman van de..> | 2025-12-10 20:09 | 185K | |
![[IMG]](/icons/image2.gif) | Bergh, Simon van den..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Bergh, Zadok van den..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Berghuis, Wiert Pauw..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Bergsma, Jacob Hendr..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Berk, Petrus Joseph ..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Berkelbach van der S..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Berkhof, Hendrikus ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Berkhout, Cornelis F..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Berkum, Petrus Paulu..> | 2025-12-10 20:09 | 184K | |
![[IMG]](/icons/image2.gif) | Berlage jr, Hendrik ..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Bernard, Frits 28 au..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Bernardus Maria Igna..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Bernet Kempers, Kare..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Berns, Anthonius Wil..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Berssenbrugge, Berna..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Besier, Louis Christ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Best, Petrus Wilhelm..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Bestebreurtje, Arie ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Besten, Pieter den 1..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Beuningen, Daniël G..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Beuningen, Hendrik A..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Beusekamp, Hendrik A..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Bichon van IJsselmon..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Bicknese, Friedrich ..> | 2025-12-10 20:09 | 185K | |
![[IMG]](/icons/image2.gif) | Bierens de Haan, Joh..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Bierens de Haan, Joh..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Biezeno, Cornelis Be..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Bijlandt, Willem Fre..> | 2025-12-10 20:09 | 184K | |
![[IMG]](/icons/image2.gif) | Bijnen, Johannes Arn..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Bijvanck, Alexander ..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Bijvanck, Geertrudus..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Bijvanck, Geertrudus..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Binnendijk, Dirk Adr..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Bitter, Cornelis 15 ..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Blaaser, Elisabeth 2..> | 2025-12-10 20:09 | 127K | |
![[IMG]](/icons/image2.gif) | Blake, George 11 Nov..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Blekemolen, Cornelis..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Blijstra, Reinder 29..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Blink, Hendrik 12-2-..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Bloemers, Henri Petr..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Blok, Adriana Cornel..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Blok, Anthonij Johan..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Blok, Henriëtte Adr..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Blok, Petrus Johanne..> | 2025-12-10 20:09 | 185K | |
![[IMG]](/icons/image2.gif) | Blom, Durk van 19-12..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Blom, Nicolaas Selho..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Blécourt, Anne Sibe..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Bodegraven, Johannes..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Boedijn, Gerardus He..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Boeijinga, Berend To..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Boeke, Julius Herman..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Boekhoven, Gerardus ..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Boekhoven, Gerrit Ja..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Boekman, Emanuel 15-..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Boelstra, Johannes 2..> | 2025-12-10 20:09 | 184K | |
![[IMG]](/icons/image2.gif) | Boer, Feike de 17-1-..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Boer, Hendrik Johann..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Boer, Jan Hendrik de..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Boer, Michael Georg ..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Boer, Sophie Adriana..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Boeree, Theodoor Ale..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Boerma, Addeke Hendr..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Boerwinkel, Feitse 1..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Boerée, Cathariné ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Bogtman, Laurens Alb..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Boissevain, Charles ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Boissevain, Gideon M..> | 2025-12-10 20:09 | 185K | |
![[IMG]](/icons/image2.gif) | Boissevain, Gideon W..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Boissevain, Jan 12-1..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Boissevain, Jan Kare..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Boissevain, Jean Hen..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Boissevain, Maria 27..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Bok, Eduard Willem G..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Bolle, Leendert 11 a..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Bomans, Arnold Jan 1..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Bomans, Jan Arnold 3..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Bomans, Johannes Ber..> | 2025-12-10 20:09 | 130K | |
![[IMG]](/icons/image2.gif) | Bomans, Oswalda Anna..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Bontekoe, Arend Andr..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Booij, James Marnix ..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Boon, Hendrik Nicola..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Boon, Jan Johannes T..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Booy, James Marnix d..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Bordewijk, Hugo Will..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Borgers, Gerrit 18 s..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Borgesius, Hendrik G..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Borghouts, Johannes ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Borghouts, Johannes ..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Borst, Jacobus Gerar..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Bos Verschuur, Berna..> | 2025-12-10 20:09 | 109K | |
![[IMG]](/icons/image2.gif) | Bos, Dirk 13 septemb..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Bosmeijer, Louise Ca..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Boss, Meinart 22 jul..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Bosscha, Johannes 18..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Bosse, Anne Antoinet..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Bottema, Oene 25 dec..> | 2025-12-10 20:09 | 180K | |
![[IMG]](/icons/image2.gif) | Bouwmeester, Louis F..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Bouwmeester, Louis F..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Braak, Menno ter 26..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Braakensiek, Johan C..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Brakel, Simon van 10..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Brandes, Jan Laurens..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Brandligt, Wolter 14..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Brands, Eugenius Ant..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Brandt, Coenraad Dir..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Brandts Buijs, Johan..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Brandts Buijs, Johan..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Breen, Johannes Chri..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Breetvelt, Henri Leo..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Bregstein, Marcel He..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Brevet, Frederik Jac..> | 2025-12-10 20:09 | 183K | |
![[IMG]](/icons/image2.gif) | Brink, Klaasje van d..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Brinkman, Johannes A..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Brockbernd, Frederik..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Broek, Antonius Joha..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Broek, Hendrik Johan..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Broek, Hendrik Johan..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Broek, Johannes Hend..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Broek, Johannes van ..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Broeksz, Johannes Ba..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Brolsma, Reinder 23-..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Brom, Gerardus Barth..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Brom, Gijsbertus 3-2..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Bromet, Meijer Salom..> | 2025-12-10 20:09 | 104K | |
![[IMG]](/icons/image2.gif) | Brondgeest, Carolus ..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Brongersma, Edward 3..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Bronsveld, Andries W..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Brooshooft, Pieter 1..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Brouwer, Cornelis La..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Brouwer, Johannes 3..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Brouwer, Johannes 21..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Brouwer, Johannes 31..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Brucken Fock, Gerard..> | 2025-12-10 20:09 | 183K | |
![[IMG]](/icons/image2.gif) | Brugmans, Hajo 5-3-..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Bruijn, Adrianus Cor..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Bruijn, Nicolaas Gov..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Bruijne, Mattheus Re..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Bruins Slot, Jan Alb..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Bruins, Angenita Eng..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Bruins, Gijsbert Wei..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Bruins, Johanna Clar..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Brummel, Leendert 1..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Brunt, Lodewijk 16-4..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Brusse, Jan Bernardu..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Brusse, Ytzen 23 feb..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Bruynzeel, Cornelis ..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Brücker, Catharina ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Buijs, Leonardus 8-..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Buisman, Pieter Henr..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Buitenrust Hettema, ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Bulterman, Jacques C..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Bungenberg de Jong, ..> | 2025-12-10 20:09 | 181K | |
![[IMG]](/icons/image2.gif) | Bungenberg de Jong, ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Burgdorffer, Abraham..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Burger, Combertus Pi..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Burger, Jacob Albert..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Burgerhout, Hugo Vic..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Burgers, Johannes Ge..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Burgers, Johannes Ma..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Burgers, Wilhelm Ger..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Buskens, Petrus Gera..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Bussemaker, Carel He..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Buuren, Johannes Ant..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Buuren, Willem Corne..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Bähler, Louis AdriÃ..> | 2025-12-10 20:09 | 255K | |
![[IMG]](/icons/image2.gif) | Böeseken, Jacob 20-..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Böttcher, Carl Joha..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Caland, Willem 27-8..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Callier, Augustinus ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Calmeijer, Michael R..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Cameron, Albert Alex..> | 2025-12-10 20:09 | 277K | |
![[IMG]](/icons/image2.gif) | Campagne, Willem Hen..> | 2025-12-10 20:09 | 153K | |
![[IMG]](/icons/image2.gif) | Campbell, Marinus Fr..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Cappellen, Willem He..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Caspers, Evert 11 no..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Cate, Laurens Othmar..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Chabot, Willem 13 me..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Citters, Schelto van..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Claij, Jacob 18-1-1..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Clay, Jacob 18 janua..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Cleber, Jozef 2-6-1..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Cleveringa [Pzn.], R..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Cluijsenaer, Jacobus..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Cobbenhagen, Martinu..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Coenen, Franciscus H..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Chrispijn, Louis Hen..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Coenen, Frans 24-4-1..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Coenen, Johannes Mei..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Cohen, Adolf Emile 4..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Cohen, Hendrik 20 de..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Cohen, Joseph 2 janu..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Cohen, Jozef Alexand..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Cohen, Lodewijk (Loe..> | 2025-12-10 20:09 | 134K | |
![[IMG]](/icons/image2.gif) | Cohen, Lida Enny 4-5..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Colenbrander, Herman..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Collem, Simon van 27..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Colnot, Karel Marinu..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Cool, Wouter 2-4-187..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Cool, Wouter 26 mei ..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Coolhaas, Willem Phi..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Coops, Jan 27-5-1894..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Copier, Andries Dirk..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Copijn, Hendrik 3-3..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Cordang, Joannes Mat..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Cornelis, Evert 5-12..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Cornelis, Evert Jr. ..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Cornelissen, Joannes..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Corput, Johannes Gua..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Corte, julius de 29 ..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Corte, Petrus de 24 ..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Coster, Dirk 7-7-188..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Craandijk, Jacobus ..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Creijghton, Josephus..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Cremer, Jacob Theodo..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Crena de Jongh, Dani..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Crommelin, Claude Au..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Crone, Cornelius Car..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Cuijpers, Josephus T..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Curiel, Adolf Frans ..> | 2025-12-10 20:09 | 147K | |
![[IMG]](/icons/image2.gif) | Curiel, Julius Chris..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Cuypers jr., Pierre ..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | d'Aulnis de Bourouil..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Daels, Franciscus Ma..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Dahmen von Buchholz,..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Dam van Isselt, Henr..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Dam van Isselt, Josi..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Dam, Bastiaan Adriaa..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Dam, Jan van 3-10-18..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Dames, Nicolaas 29-..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Damme, Marinus Hendr..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Dammerman, Karel Wil..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Damsté, Henri Titus..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Dantzig, Maurits Mic..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Dantzig, Rachel Marg..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Dasberg, Simon 13-11..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Daum, Paulus Adrianu..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Davids, Arnold 18 me..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Davids, Aäron Baren..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Deelder, Cornelis 15..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Deene, Johannes Fran..> | 2025-12-10 20:09 | 78K | |
![[IMG]](/icons/image2.gif) | Deinse, Antonius Bou..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Dekhuyzen, Pieter Ni..> | 2025-12-10 20:09 | 185K | |
![[IMG]](/icons/image2.gif) | Delfgaauw, Gerardus ..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Dellaert, Ulrich Fra..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Dellepoort, Johannes..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Delprat, Guillaúme ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Dentz, Theodore 9-8-..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Derksen, Petrus Hube..> | 2025-12-10 20:09 | 190K | |
![[SND]](/icons/sound2.gif) | desktop.ini | 2025-12-10 20:09 | 520 | |
![[IMG]](/icons/image2.gif) | Deure, Abraham van d..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Deventer, Charles Ma..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Deventer, Conrad The..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Dieben, Willem Frede..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Diemer, Hendrik 13-2..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Dien, Elsa van 12 j..> | 2025-12-10 20:09 | 117K | |
![[IMG]](/icons/image2.gif) | Diepen, Arnold Frans..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Diepen, Frederik Jan..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Diepenhorst, Isaäc ..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Diepenhorst, Pieter ..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Dieren, Bernard Hél..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Diesen, Gerrit van 2..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Diferee, Hendrik Car..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Dijck, Johannes Vitu..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Dijk, Antoinette van..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Dijk, Evert van 23-5..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Dijk, Jannes Johanne..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Dijk, Johannes Herma..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Dijke, Krijn Marinus..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Dijserinck, Esther W..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Dikkentman, Pieter C..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Dillen, Johannes Ger..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Dinaux, Carel Jules ..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Dirks, Judoca Cathar..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Dissel, Etienne Dani..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Dito, Johannes Karel..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Dix, Johan Frederik ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Dobbelmann, Petrus T..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Doderer, Johan Heinr..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Dodewaard, Johannes ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Doesburgh, Hendrik G..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Doesschate, Johan Fr..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Dokkum, Hans Marinus..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Domburg, Adrianus Jo..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Domela Nieuwenhuis, ..> | 2025-12-10 20:09 | 185K | |
![[IMG]](/icons/image2.gif) | Domela Nieuwenhuis, ..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Domela Nieuwenhuis, ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Dommelen, Johannes S..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Dommerholt, Hendrika..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Donker, Leendert Ant..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Donkersloot, Nicolaa..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Doorn, Henri Willem ..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Dorren, Corneille Ja..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Dorssen, Hendrika Ak..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Doude van Troostwijk..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Douwes, Petrus Arnol..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Draaisma , Geertruid..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Drehmans, Joseph Hub..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Dresden, Samuel 5 au..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Dresselhuijs, Hendri..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Driessen, Maximiliaa..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Drion, Huibert 25 ap..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Drion, Jan 30 decemb..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Drucker, Hendrik Lod..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Dubois, Antoine 3-11..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Dubois, Marie Eugèn..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Dubois, Pierre Huber..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Duijnstee, Frans Joz..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Duiker, Johannes 1-3..> | 2025-12-10 20:09 | 185K | |
![[IMG]](/icons/image2.gif) | Dupré, Charles Eliz..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Durrer, Dirk 19 apri..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Dutilh, Christian Co..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Dutilh, Jacques 19 j..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Duymaer van Twist, L..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Duynstee, Willem Jac..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Duys, Jan Eliza Wilh..> | 2025-12-10 20:09 | 177K | |
![[IMG]](/icons/image2.gif) | Duyvendak, Jan Juliu..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Dénis, Henri Léona..> | 2025-12-10 20:09 | 184K | |
![[IMG]](/icons/image2.gif) | Eck, Dirk van 2-8-19..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Edelman, Cornelis He..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Edgar, George Willem..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Eeghen, Jacob van 21..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Eeghen, Samuel Piete..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Eerdmans, Matthijs ..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Eernstman, Tjeerd 5..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Eesteren, Cornelis v..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Eesteren, Jacobus Pi..> | 2025-12-10 20:09 | 185K | |
![[IMG]](/icons/image2.gif) | Egeraat, Leonardus S..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Eggens, Jannes 20-10..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Egmond, Pieter van 1..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Eijk, Henrietta Cath..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Eijk, Pieter Nicolaa..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Eijkman, Christiaan ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Eijkman, Gerard Chri..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Eijkman, Johan 28-7-..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Eijkman, Johan Fredr..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Eijsden, Hendrik van..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Eijssell, Aernout Ph..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Elffers, Cornelis 18..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Elffers, Dirk Cornel..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Elias, Eduard Maurit..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Elias, Eduard Maurit..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Elias, Johan Engelbe..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Ellis, Abraham Georg..> | 2025-12-10 20:09 | 87K | |
![[IMG]](/icons/image2.gif) | Elsen , Jozef van 22..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Elsen, Godefridus va..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Emanuels, Severinus ..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Embden, David van 2..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Emde Boas, Coenraad ..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Endert, Dirk Christi..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Engelbronner, Carel ..> | 2025-12-10 20:09 | 184K | |
![[IMG]](/icons/image2.gif) | Engelman, Johannes A..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Engels, Jacobus Alph..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Engelschman, Nico 12..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Enklaar, Diederik Th..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Erens, Maria Joseph ..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Erens, Maria Joseph ..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | ernhout, Edgar Richa..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Ernste, Jan Willem ..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Escher, Berend Georg..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Esmeijer, Samuel 20 ..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Essed, Franklin Edga..> | 2025-12-10 20:09 | 170K | |
![[IMG]](/icons/image2.gif) | Evenhuis, Egbert 1 n..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Everdingen, Ewoud va..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Evers, Hendrik Jorde..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Everts, Johannes 18-..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Eysinga, Willem Jan ..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Fabius, Dammes Paulu..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Fabius, Jan 5-7-188..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Faverey, Alphonsus I..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Feith, Jhr. Rhijnvis..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Feith, Johan Adriaan..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Fernandes, Abraham S..> | 2025-12-10 20:09 | 123K | |
![[IMG]](/icons/image2.gif) | Fernhout , Hendrik 1..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Fernhout, Edgar Rich..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Fernhout, Johannes H..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Feron, Frans Joseph ..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Ferrier, Johan Henri..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Ferwerda, Hendrikus ..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Feylbrief, Jan Koos ..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Fimmen, Eduard Carl ..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Fischer, Herman Fred..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Fisenne, Pieter Mari..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Fiévez, Alexander H..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Flaes, Reijnier 14-..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Flipse, Eduard 26-2-..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Flu, Paul Christiaan..> | 2025-12-10 20:09 | 119K | |
![[IMG]](/icons/image2.gif) | Fock, Cornelis 29-1..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Fock, Dirk 19-6-18..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Fockema Andreae, Joa..> | 2025-12-10 20:09 | 183K | |
![[IMG]](/icons/image2.gif) | Fockema Andreae, Sij..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Fockema Andreae, Syb..> | 2025-12-10 20:09 | 316K | |
![[IMG]](/icons/image2.gif) | Fokker, Eduard 14-7-..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Forbes, Robert Jacob..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Fortmann, Henricus M..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Fortmann, Herman Joa..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Franchimont, Antoine..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Franco, Isaac 1-1-18..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Frankot, Roelof 25 ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Franssen, Johanna Fr..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | François, Jean Pier..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Frencken, Franciscus..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Frenkel, Theodorus M..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Friedericy, Herman J..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Friedhoff, Gijsbert ..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Frietema, Harmen Job..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Fruin, Jacobus Antho..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Fruin, Robert 22-11-..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Fruin, Robert Jacobu..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Fuld, Lazarus Octobe..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Funke Küpper, Franc..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Funke Küpper, Theod..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Furstner, Johannes T..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Gaag, Jacob van der ..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Gaay Fortman, Wilhel..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Gaerthé, Catharina ..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Gasteren, Louis Alph..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Geels, Pierre Louis ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Geerdinck, Johannes ..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Geijl, Pieter Cathar..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Gelder, Cornelis de ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Gelder, Hendrik Enno..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Gelder, Herman Arend..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Gelder, Jan Gerrit v..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Gelderen, Jacob van ..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Gelderman, Joan 14-1..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Gelissen, Henri Casp..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Genechten, Robert va..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Gerhard, Hendrik 11 ..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Gerhardt, Mia Irene ..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Gessel, Eugène Albe..> | 2025-12-10 20:09 | 142K | |
![[IMG]](/icons/image2.gif) | Gevel, Wouter van de..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Gideonse, Hendrik Da..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Gier, Rutgerus Johan..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Giffen, Albert Egges..> | 2025-12-10 20:09 | 185K | |
![[IMG]](/icons/image2.gif) | Giljam, Job Boudewij..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Gils, Jacobus Wilhel..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Gils, Petrus Josephu..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Gilse, Jan Pieter He..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Ginneken, Jacobus Jo..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Glans, Leo Hendrique..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Gits, Bernard Antoon..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Glansdorp, Aart 3 ju..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Glansdorp, Marien Ge..> | 2025-12-10 20:09 | 185K | |
![[IMG]](/icons/image2.gif) | Glimmerveen, Cathari..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Gobée, Emile 3-12-..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Godin de Beaufort, K..> | 2025-12-10 20:09 | 183K | |
![[IMG]](/icons/image2.gif) | Godin de Beaufort, K..> | 2025-12-10 20:09 | 185K | |
![[IMG]](/icons/image2.gif) | Goedewaagen, Tobie 1..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Goes van Naters, Mar..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Gorter, Evert 19 feb..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Gorter, Hendrikus Ja..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Gorter, Hendrikus Ja..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Gorter, Hendrikus Ja..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Gorter, Herman 26 No..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Gortzak, Hendricus 2..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Gosens, Martinus Pie..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Goslinga, Adriaan 26..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Gosses, Frans 5-6-1..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Gosses, Izaak Hendri..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Goudkuil, Anna 15 ma..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Goudoever, Louis Chr..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Goudriaan, Albert Jo..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Goudriaan, Jan 5-12-..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Goudstikker, Sophia ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Graaff, Herman Hendr..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Graaff, Simon de 24..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Graef, August Juliaa..> | 2025-12-10 20:09 | 185K | |
![[IMG]](/icons/image2.gif) | Graef, Hendrik Jan d..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Graef, Julien Gustav..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Graff, Georg Adam 3 ..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Graswinckel, Dirk Pe..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Gratama, Seerp 14-12..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Gravemeijer, Koeno H..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Greeve, Henri Theodo..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Greidanus, Johan Hen..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Greidanus, Tjardus ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Greshoff, Jan 15 dec..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Greven, Hendrik Bare..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Griend, Jacobus van ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Grijns, Gerrit 28 me..> | 2025-12-10 20:09 | 183K | |
![[IMG]](/icons/image2.gif) | Grinten, Jozef Huber..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Grisnigt, Reijer Abr..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Groeneveld, Gijsbert..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Groeningen, August P..> | 2025-12-10 20:09 | 184K | |
![[IMG]](/icons/image2.gif) | Groot, Adrianus Ding..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Groningen, Lucie van..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Groot, Cornelius Joh..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Groot, Gerard Johann..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Groot, Hendrik Jacob..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Groot, Henri Francis..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Groot, Johannes de 7..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Groot, Johannes Jaco..> | 2025-12-10 20:09 | 185K | |
![[IMG]](/icons/image2.gif) | Groot, Saul de 19 ju..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Grootens, Adrianus J..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Grosheide, Frederik ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Grosheide, Gerhardus..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Grossouw, Willem Kar..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Grégoire, Paul 21 f..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Gul, Gerrit 27 oktob..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Gulik, Robbert Hans ..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Gunnewegh, Wilhelmus..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Gunning, Johannes He..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Gunning, Maximiliaan..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Görris, Gerhard Car..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Götzen, Lubbertus ..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Haagen, Jan Karel va..> | 2025-12-10 20:09 | 181K | |
![[IMG]](/icons/image2.gif) | Haagsma, Sjoerd Epco..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Haan, Frederik de 22..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Haas, Adrianus Johan..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Haas, Gerardus Horre..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Haas, Marc de 2-7-1..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Hacke, Aart Hendrik ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Haeringen, Coenraad ..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Hagen, Cornelis Joha..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Haighton, Coenraad A..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Hajary, Marie Majoie..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Hall, Floris Adriaan..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Hall, Hendrik Johann..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Halle, Leonard Gerri..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Hallema, Anne 8-9-1..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Hamaker, Hendrik Jac..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Hamburger, Salomon H..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Hamel, Anton Gerard ..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Hamel, Gerardus Anto..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Hamer, Ferdinand Hub..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Hanken, Henri Adriaa..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Hannik, Charlotte Aa..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Hans Wijnberg of Han..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Hanssen, Jan Michel ..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Hardenberg, Herman 1..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Harder, Johannes Lam..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Harderwijk, Petrus J..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Harinxma thoe Sloote..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Hart, George Henry C..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Hart, Simon 24-3-19..> | 2025-12-10 20:09 | 175K | |
![[IMG]](/icons/image2.gif) | Harte van Tecklenbur..> | 2025-12-10 20:09 | 183K | |
![[IMG]](/icons/image2.gif) | Harthoorn, Antonie M..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Hans, Doe 4-12-1882..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Harting, Pieter 27 f..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Hartmann, Maria Eliz..> | 2025-12-10 20:09 | 125K | |
![[IMG]](/icons/image2.gif) | Hartogh, Leopold de ..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Hartogs, Jacques Coe..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Hartong, Hendrina Co..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Hasselman, Benjamin ..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Hasselman, Catharinu..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Hasselt, Jules van 1..> | 2025-12-10 20:09 | 180K | |
![[IMG]](/icons/image2.gif) | Have, Amelie Jeanne ..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Have, Christina Adri..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Havelaar, David Hend..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Havelaar, Jacob Petr..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Havelaar, Willem Jus..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Hazelzet, Pieter Le..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Hazeu, Godard Arend ..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Heddema, Sixta Lamch..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Heeckeren tot Kell, ..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Heek, Frederik van 1..> | 2025-12-10 20:09 | 123K | |
![[IMG]](/icons/image2.gif) | Heek, Gerrit Jan van..> | 2025-12-10 20:09 | 183K | |
![[IMG]](/icons/image2.gif) | Heek, Jan Herman van..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Heel, Gerardus Henri..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Heemskerck Van Beest..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Heemskerk, Theodorus..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Heemstra , Ella van ..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Heemstra, Aarnoud Ja..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Heemstra, Schelto va..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Heeris, Floris Johan..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Heerma van Voss, Syb..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Heeroma, Klaas Hanze..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Hees, Adriaan Nicola..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Heidstra, Hans 29-4..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Heijberg, Johannes G..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Heijden, Egidius Joh..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Heijermans, Catharin..> | 2025-12-10 20:09 | 185K | |
![[IMG]](/icons/image2.gif) | Heijmans, Laurentius..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Heijnis, Aafje 2-5-..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Heijnsbergen, Pieter..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Heimans, Eli 28-2-1..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Heimans, Eli 28 febr..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Heimans, Jacobus 29-..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Helders, Gerardus Ph..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Heldring, Alexander ..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Heldring, Ernst 21-..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Heldt, Bernardus Her..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Hellinga, Wytze, 20..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Helsdingen, Willem P..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Hem, Pieter van der ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Hemert tot Dingshof,..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Hendrikse, Johannes ..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Hendrix, Petrus Joha..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Hengel, Adrianus Joh..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Henkes, Gerke 25 ju..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Henkes, Roelof Lucas..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Hennipman, Pieter 12..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Henriët, Hendricus ..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Hermans, Adriana 6 n..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Hermesdorf, Bernardu..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Heskes, Willem Frede..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Hettema, Foeke 6-6-..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Heukels, Hendrik 11-..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Heukelum, Gerardus W..> | 2025-12-10 20:09 | 146K | |
![[IMG]](/icons/image2.gif) | Heutsz, Joannes Bene..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Heydenryck, Christia..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Hijmans, Abraham Alb..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Hijmans, Isaac Henri..> | 2025-12-10 20:09 | 177K | |
![[IMG]](/icons/image2.gif) | Hille, Johann Christ..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Hillen, Willem Piete..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Hinloopen Labberton,..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Hintzen, George Herm..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Hoboken, Anthony van..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Hochwald, Theodorus ..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Hoeben, Henricus Joh..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Hoefer, Frederic Ado..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Hoek, Gerard Hendrik..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Hoek, Paulus Peroniu..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Hoek, Petrus van 18..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Hoes, Johannes Andre..> | 2025-12-10 20:09 | 179K | |
![[IMG]](/icons/image2.gif) | Hoeven, Govert Georg..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Hoff, Bert van 't 2..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Hoff, Robbert van 't..> | 2025-12-10 20:09 | 183K | |
![[IMG]](/icons/image2.gif) | Hofhuizen, Wilhelmus..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Hofstede de Groot, C..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Hofstee, Evert Wille..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Hofstra, Sjoerd 21-1..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Hoijtema, Theodoor v..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Hol, Amalia Jacoba 2..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Hoeven, Henri van de..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Hol, Elisabeth Bregi..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Hol, Elisabeth Bregi..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Holk, Lambertus Jaco..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Hollander, Arie Nico..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Hollander, Franciscu..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Hollander, Hartog 5..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Holle, Carel Frederi..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Holleman, Arnold Fre..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Holsbergen, Jan Will..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Holst, Gilles 20-3-..> | 2025-12-10 20:09 | 185K | |
![[IMG]](/icons/image2.gif) | Holtrop, Marius Wilh..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Holwerda, Jan Hendri..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Hond, Meyer de 30-8..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Hoogewerff, Godefrid..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Hoogewerff, Sebastia..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Hoogveld, Johannes H..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Hooijkaas, Isaac Pet..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Hopmans, Adrianus Pe..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Hopmans, Adrianus Pe..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Horn, Leopold Sailvi..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Horst, Anthonie van ..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Horst, Theodoor van ..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Hotz, Frits Bernard ..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Houben, François Jo..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Hout, Wilhelmus Henr..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Houten, Hendrik van ..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Houten, Sientje van ..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Houven van Oordt, Jo..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Houwink, Roelof Mart..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Hove, Bartholomeus J..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Hove, Gerardus Johan..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Hovy, Willem 17-7-1..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Huart, Frederik Joha..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Hubrecht, Abrahamina..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Hubrecht, Ambrosius ..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Hudig, Dirk 16-9-18..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Hudig, Dirk 13-10-18..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Huf, Emmy Mary Rose ..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Huf, Paul Eduard Bra..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Hugenholtz, Johannes..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Hugten, Herman Jozef..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Huibers, Johannes Pe..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Huijbers, Bernardus ..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Huijbers, Henricus F..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Huijkman, Isidoor 20..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Huijsmans, Gerardus ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Huiswoud, Otto Eduar..> | 2025-12-10 20:09 | 130K | |
![[IMG]](/icons/image2.gif) | Hullu, Johannes de ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Hulshoff, Abram 6-1..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Hulst, Hendrik Chris..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Hulst, Willem Gerrit..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Hurk, Peter Jan van ..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Hustinx, Charles Mar..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Hutschenruijter, Wil..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Hutschenruijter, Wou..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Hutschenruyter, Wout..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Hynckes, Raoul 11 m..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Hörburger, Anton 17..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Hörburger, Arnold 1..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Hövell van Wezeveld..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Höweler, Casper And..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Ibo, Johan Willem 10..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Idema, Hijltje Alber..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Idzerda, Hans Henric..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Ihle, Johan Egbert W..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | IJzerdraat, Bernardu..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Immink, Adrianus Joh..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Immink, Petrus WernÃ..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Ingen Housz, Arnold ..> | 2025-12-10 20:09 | 182K | |
![[IMG]](/icons/image2.gif) | Iterson, Frederik Ka..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Itterzon, Gerrit Pie..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Jabaaij, Pleun 17 ma..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Jacob, Frederik Bern..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Jacobs, Ezechiël 2..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Jaeger, Frans Maurit..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Jan Gerrit van Gelde..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Jansen, Anna Maria C..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Jansen, Herman Gerar..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Jansen, Joannes Hend..> | 2025-12-10 20:09 | 165K | |
![[IMG]](/icons/image2.gif) | Jansen, Martien Anto..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Jansen, Pieter 25 ja..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Janssen, Hubertus Wi..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Japikse, Nicolas 29..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Janssen, Hubertus Wi..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Jelgersma, Gerbrandu..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Jesse, Nico Adriaan ..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Jofriet, Jan Gerardu..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Johan Brautigam 18 m..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Jolles, Johannes And..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Jolles, Tettje Clasi..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Jong van Beek en Don..> | 2025-12-10 20:09 | 149K | |
![[IMG]](/icons/image2.gif) | Jong, Aaltje de 18-1..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Jong, Adriaan Marie ..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Jong, Adrianus Michi..> | 2025-12-10 20:09 | 249K | |
![[IMG]](/icons/image2.gif) | Jong, Albert Andries..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Jong, Cornelis Johan..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Jong, Hantje de 11 ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Jong, Petrus Josef S..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Jonge, Bonifacius Co..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Jonge, Bonifacius Co..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Jonge, Johan Antoni ..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Jongeling, Pieter 31..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Jongh, Gerrit Johann..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Jongmans, Wilhelmus ..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Joor Bastiaan Verhei..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Jordaan, Leendert Ju..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Jorissen, Eduard Joh..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Jorissen, Willem Pau..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Josephus Jitta, Dani..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Josselin de Jong, Ja..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Josselin de Jong, Pi..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Junius, Sophia Marga..> | 2025-12-10 20:09 | 320K | |
![[IMG]](/icons/image2.gif) | Jurgens, Antonius Jo..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Jurgens, Antonius Jo..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Jurgens, Johannes Wi..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Jurres, Johannes Hen..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Kaag, Henricus Anton..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Kaaij, Willem van de..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Kaart, Johannes Anto..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Kaas, Jacobus 4-8-1..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Kadt, Jacques de 30..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Kafiluddi, Samuel 5 ..> | 2025-12-10 20:09 | 139K | |
![[IMG]](/icons/image2.gif) | Kagchelland, Daniël..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Kalff, Gerrit 30-6-1..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Kalff, Jacob Adriaan..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Kamphuisen, Pieter W..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Kampinga, Herman 11-..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Kamstra, Rients 24-9..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Kan, Adam Hubert Mar..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Kan, Johannes Benedi..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Kann, Jacobus Henric..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Kapteijn, Albertus P..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Kar, Eliazer van de ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Karamat Ali, Mohamed..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Karnebeek, Abraham P..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Karnebeek, Herman Ad..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Katan, Hans 9 august..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Kate, Herman Frederi..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Kelder, Anthonius Be..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Kempe, Gerrit Theodo..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Kempen, Dingeman Pie..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Kenninck, Franciscus..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Kern, Rudolf Arnoud ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Kernkamp, Gerhard Wi..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Kernkamp, Gerhard Wi..> | 2025-12-10 20:09 | 182K | |
![[IMG]](/icons/image2.gif) | Kessen, Antonius Hub..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Kessler, Jean Baptis..> | 2025-12-10 20:09 | 177K | |
![[IMG]](/icons/image2.gif) | Kesteren, Carel Eliz..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Kettmann, George Wil..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Keuls, Henricus Wijb..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Kickert, Johan Conra..> | 2025-12-10 20:09 | 200K | |
![[IMG]](/icons/image2.gif) | Kieboom, Cornelis Ro..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Kief, Carl Friedrich..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Kielstra, Johannes C..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Kiestra, Douwe 4-12-..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Kieviet , Cornelis J..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Kiewiet de Jonge, He..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Kilsdonk, Johannes C..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Kiès, Paul Charles ..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Klaasse, Cornelis Ab..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Klaauw, Cornelis Jak..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Klapwijk, Gerrit Cor..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Klaver, Clara Helena..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Kleef, Bastiaan Abra..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Kleerekoper, Salomon..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Klein, Willem 4 dec..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Klein, Leo Henri 4 a..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Kletter, Guno Benjam..> | 2025-12-10 20:09 | 119K | |
![[IMG]](/icons/image2.gif) | Kloos, Andries Hein ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Kloos, Jan Piet 11 j..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Kloos, Willem Johann..> | 2025-12-10 20:09 | 320K | |
![[IMG]](/icons/image2.gif) | Kluppell, Catharina ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Kluwer, Æbele [Ever..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Knappert, Laurentius..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Knip, Henriette 31-5..> | 2025-12-10 20:09 | 182K | |
![[IMG]](/icons/image2.gif) | Knip, Wilhelm Alexan..> | 2025-12-10 20:09 | 129K | |
![[IMG]](/icons/image2.gif) | Knobel, Fridolin Mar..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Knoef, Jan 22-8-1896..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Knuttel, Gerhardus ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Knuttel, Willem Piet..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Knuvelder, Gerardus ..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Koch, Daniël Marcel..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Koejemans, Anthoon J..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Koekoek, Hendrik 22-..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Koenders, Juluis Geo..> | 2025-12-10 20:09 | 125K | |
![[IMG]](/icons/image2.gif) | Koene, Jacoba Brigit..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Koenen, Salomon 20-..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Koenraad, Pieter 6-6..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Koenraadt, Wilhelmus..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Koetsveld, Cornelis ..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Koeverden, Wilhelmus..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Kok, Jan 13-6-1899 1..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Koksma, Jurjen Ferdi..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Kol, Hendrikus Huber..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Kol, Hendrikus Huber..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Kolader, Paul August..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Kolff, Gualtherus Jo..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Kolff, Henriette Jea..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Kolfschoten, Henri A..> | 2025-12-10 20:09 | 173K | |
![[IMG]](/icons/image2.gif) | Kolkman, Maximilien ..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Kollewijn, Roeland A..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Kollewijn, Roeland A..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Kollewijn, Roeland D..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Koo, Johannes de 13..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Koolemans Beijnen, G..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Koolen, Dionysius Ad..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Koolhoven, Sijtse Fr..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Koomans, Nicolaas 1..> | 2025-12-10 20:09 | 181K | |
![[IMG]](/icons/image2.gif) | Koopmans, Jan 26 maa..> | 2025-12-10 20:09 | 178K | |
![[IMG]](/icons/image2.gif) | Koopmans, Johan Gerb..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Koornstra, Metten Te..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Korpershoek, Leender..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Kors, Joannes August..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Kort, Willebrordus L..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Korte, Abraham de 11..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Kortenhorst, Carel T..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Korthals, Hendrik Al..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Kortlandt, Adriaan 2..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Kortooms, Antonius J..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Korver, Johannes Mar..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Kossmann, Friedrich ..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Kosters, Jan 1-11-18..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Koudijs, Gerda Johan..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Kouwenaar, Gerrit 9 ..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Krabbe, Hugo 3-2-18..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Kralingen, Cornelis ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Kranenburg, Roelof 8..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Krelage, Ernst Heinr..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Kreling, Gerhardus M..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Kresse, Hans Georg ..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Kreukniet, Pieter Ba..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Kouwenhoven, Dirk 12..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Kreunen Mees, Maria ..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Krom, Nicolaas Johan..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Kromhout, Willem 10 ..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Krook, Lourens 13 o..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Krook, Lourens 15 o..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Kruijff, Hendrik Pie..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Kruijff, Willem Henr..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Kruijt, Jakob Pieter..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Kruitwagen, Francisc..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Kruls, Hendrik Johan..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Kruseman, Adriaan 27..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Kuijpers, Hendrik 8-..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Kuile, Gijsbert Joha..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Kuiper, Anna Corneli..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Kuiper, Cornelis Jac..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Kuiper, Frederik 7-1..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Kuiper, Nicolaas Hen..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Kuiper, Pieter Corne..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Kuiperbak, Johan Geo..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Kuipers, Abe Johanne..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Kuipers, Reinold 26 ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Kuipers, Tjeerd 21-..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Kuitenbrouwer, Louis..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Kun, Emile Alexis Ma..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Kunst, Antonie Johan..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Kunst, Jakob, etnomu..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Kuntze, Carl Erich E..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Kuntze, Carl Friedri..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Kurpershoek, Theodor..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | La Blanc, Pieter 26 ..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Laan, Jan ter 12 dec..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Laan, Kornelis ter ..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Laan, Kornelis ter 8..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Laar, Adolf Robbert ..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Laar, Arnoldus Wilhe..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Laar, Johannes Jacob..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Lagendaal, Willem 13..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Lagerweij, Engelbert..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Lam, Herman Johannes..> | 2025-12-10 20:09 | 184K | |
![[IMG]](/icons/image2.gif) | Lamberts, Johannes H..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Lamme, Arie Johannes..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Lammerts, Nelly Hend..> | 2025-12-10 20:09 | 185K | |
![[IMG]](/icons/image2.gif) | Lamping, Arnold Theo..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Landheer, Johanna Pe..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Landman, Janneke Joh..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Landman, Willem 13 a..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Landré, Johannes Ma..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Lange, Daniël de 11..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Lange, Jacob Bernard..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Lange, Johanna Henri..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Lange, Samuel de 22 ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Lange, Samuel de jr...> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Lange, Samuel jr. de..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Langen, Willem Jan d..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Langestraat, Willem ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Langguth Oliviera, F..> | 2025-12-10 20:09 | 131K | |
![[IMG]](/icons/image2.gif) | Lanjouw, Joseph 21-8..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Lankeren Matthes, Ol..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Lankhorst, Hendrik J..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Lans, Carl Theodoor ..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Lanschot, Frans Joha..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Lanschot, Johannes M..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Lau, Louisa Petronel..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Laudij, Leonardus Al..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Lebon, Jan Willem 14..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Ledden Hulsebosch, C..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Leeflang, Arnoldus 2..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Leenen, Pleun van 2 ..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Leer, Bernard van 2..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Leeuw, Cornelis Hend..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Leeuw, François Jos..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Leeuw, Henri jr. 7 o..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Leeuw, Jacobus Johan..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Leeuw, Jean Henri 28..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Leeuw, Johanna van d..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Leeuw, Marius Adrian..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Leeuwen, Ferdinanda ..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Leeuwen, Wilhelmus H..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Lehmann, Louis Theod..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Lelyveld, Caroline R..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Lemaire, Cornelis Jo..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Lemmens, Joseph Hube..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Lenglet, Willem Joha..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Lennep, Emile van 20..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Leur, Jacob Cornelis..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Levisson, Abraham Sa..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Lichtenauer, Wilhelm..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Lichtveld, Lodewijk ..> | 2025-12-10 20:09 | 284K | |
![[IMG]](/icons/image2.gif) | Lier, Charles van 5 ..> | 2025-12-10 20:09 | 183K | |
![[IMG]](/icons/image2.gif) | Lier, Lambertus van ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Lier, Rudolf Asueer ..> | 2025-12-10 20:09 | 123K | |
![[IMG]](/icons/image2.gif) | Lijon, George Henrij..> | 2025-12-10 20:09 | 159K | |
![[IMG]](/icons/image2.gif) | Lijon, George Henry ..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Limperg, Koenraad 19..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Limperg, Théodore 2..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Lindeboom, Gerrit Ar..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Lindeboom, Johannes ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Linden, Cornelis van..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Linschoten, Pieterne..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Lint, Jan Gerard de ..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Linthorst Homan, Joh..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Lips, Jacobus 21 sep..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Lobato, Max Izak 22 ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Lobrij van Troostenb..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Locher, Theodor Jako..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Loder, Bernard Corne..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Loeff, Johannes Alou..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Loerakker, Anthonius..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Logemann, Johann Hei..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Loghem, Johannes Ber..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Lohuizen, Catharina ..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Lohuizen, Theodoor K..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Loon, Hendrik Willem..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Losecaat Vermeer, Pi..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Loth, Willem Lodewij..> | 2025-12-10 20:09 | 108K | |
![[IMG]](/icons/image2.gif) | Loudon, Alexander 5..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Loudon, John 18-3-1..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Loudon, John Francis..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Louter, Jan de 3-8-..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Louwerse, Pieter 23..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Louwes, Herman Derk ..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Louwes, Stephanus Lo..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Lovink, Antonius Her..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Lovink, Hermanus Joh..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Lubberhuizen, Geertj..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Luden, Johannes 23-1..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Lugt Melsert, Cornel..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Lugt, Frederik Johan..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Luns, Théodore Mari..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Lunshof, Hendrik Ari..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Lunzen, Harm van 8-..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Lutkie, Wouterus Leo..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Lutz, Johannes Herma..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Lynden, Alexander Fr..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Léons, Max Nico 24 ..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Lücker, Eugène Jos..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Lücker, Eugène Jos..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Maarse, Jacob 12-9-1..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Maarseveen, Johannes..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Maas, Arnoldus Josep..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Maas, Hendricus Jaco..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Maas, Jean Baptist M..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Maasbach, Johannes 5..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Maasland, Arie 26 me..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Machen, William Char..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Mackenzie, Marie Hen..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Made, Gerard Joannes..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Made, Johannes Alber..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Madern, Gerrit 29 ju..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Maenen, Johannes Hub..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Mak, Catrinus 28 se..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Malcorps, Gertrude J..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Malcorps, Marcus Hen..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Man, Johannes Govert..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Man, Maria Goverdina..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Mandele, Karel Paul ..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Manders, Antoon 24 o..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Manger, Johannes Ber..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Mankes, Beint 1 Marc..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Marchant et d'Ansemb..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Marcus Bakker 20 jun..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Margrij, Everhardus ..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Margry, Albertus Arn..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Margry, Joseph Johan..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Margry, Josephus Cor..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Marijnen, Victor Ger..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Marion, Simon van 7 ..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Maronier, Jan Hendri..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Masséus, Jan 28 jan..> | 2025-12-10 20:09 | 183K | |
![[IMG]](/icons/image2.gif) | Mastenbroek, Hendrik..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Mastrigt, Cornelis J..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Margry, Everardus Jo..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Matser, Christiaan G..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Matthes, Agneta Wilh..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | May, Arthur Johan 2 ..> | 2025-12-10 20:09 | 187K | |
![[IMG]](/icons/image2.gif) | Meel, Marinus van 28..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Meer de Walcheren, P..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Meer, Frederik Gerbe..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | meerling schipaanboo..> | 2025-12-10 20:09 | 316K | |
![[IMG]](/icons/image2.gif) | Meerum Terwogt, Albe..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Mees, Fokko Alting 2..> | 2025-12-10 20:09 | 178K | |
![[IMG]](/icons/image2.gif) | Mees, Hermanus Ellen..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Mees, Marten 24-10-..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Mees, Marten 24 okto..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Meester, Theodoor He..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Meeuwessen, Louis Ma..> | 2025-12-10 20:09 | 186K | |
![[IMG]](/icons/image2.gif) | Meggelen, Sophia van..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Meijenfeldt, Michiel..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Meijer, Arnoldus Joz..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Meijer, Bernhard com..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Meijer, Jan 30-3-19..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Meijer, Jan Cornelis..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Meijer, Salomon 6 de..> | 2025-12-10 20:09 | 159K | |
![[IMG]](/icons/image2.gif) | Meinsma, Koenraad Oe..> | 2025-12-10 20:09 | 184K | |
![[IMG]](/icons/image2.gif) | Meis, Frederik 17-1..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Mekel, Johannes Anto..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Mellema, Cornelius M..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Metz, Louise Estella..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Metzelaar, Johan Fre..> | 2025-12-10 20:09 | 191K | |
![[IMG]](/icons/image2.gif) | Metzelaar, Willem Co..> | 2025-12-10 20:09 | 188K | |
![[IMG]](/icons/image2.gif) | Meuldijk, Willem 8 j..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Meulen, Albertine El..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Meulen, Johanna Elis..> | 2025-12-10 20:09 | 189K | |
![[IMG]](/icons/image2.gif) | Michielsen, Cornelis..> | 2025-12-10 20:09 | 192K | |
![[IMG]](/icons/image2.gif) | Miedema, Johannes 21..> | 2025-12-10 20:09 | 190K | |
![[IMG]](/icons/image2.gif) | Miedema, Rein 19 aug..> | 2025-12-10 20:10 | 187K | |
![[IMG]](/icons/image2.gif) | Miedema, Simon 13 ju..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Mil, Arnoldus Johann..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Min, Jacob 16 septem..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Minderop, Hendrikus ..> | 2025-12-10 20:10 | 187K | |
![[IMG]](/icons/image2.gif) | Miranda, Julius Cesa..> | 2025-12-10 20:10 | 110K | |
![[IMG]](/icons/image2.gif) | Moens, Herman Marie ..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Mol, Albert 3 januar..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Molen, Gezina Hermin..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Molen, Jan van der 1..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Molengraaff, Willem ..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Molhuijsen, Philipp ..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Molijn, Petrus Mariu..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Moll, Jan Willem 3 j..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Monchy, Salomon Jean..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Mooij, Arend Theodoo..> | 2025-12-10 20:10 | 187K | |
![[IMG]](/icons/image2.gif) | Moor, Pieter Corneli..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Moret, Barent 8 juni..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Morpurgo, Alfred Joh..> | 2025-12-10 20:10 | 149K | |
![[IMG]](/icons/image2.gif) | Mossel, Isaäc 22 ap..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Moulijn, Simon 20 ju..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Mourik Broekman, Ger..> | 2025-12-10 20:10 | 184K | |
![[IMG]](/icons/image2.gif) | Mozer, Gerrit Reinie..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Mulder, Willem Johan..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Mulderije, Hendrik ..> | 2025-12-10 20:10 | 186K | |
![[IMG]](/icons/image2.gif) | Mulier, Willem Johan..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Muller Jzn., Frederi..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Muller, Frederik 22 ..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Muller, Hendrik Piet..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Muller, Julius Eduar..> | 2025-12-10 20:10 | 115K | |
![[IMG]](/icons/image2.gif) | Muller, Samuel 22 ja..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Muntendam, Pieter 22..> | 2025-12-10 20:10 | 187K | |
![[IMG]](/icons/image2.gif) | Musaph, Heijman 7 ja..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Musscher, Johannes H..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Mutsaerts, Wilhelmus..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Möller, Johann Bern..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Naamen van Eemnes, A..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Nachenius, Diederich..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Nachenius, Jan Coenr..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Nederlof, Arie Basti..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Nederveen, Alexander..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Nederveen, Alexander..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Neher, Lambertus 13..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Netscher, Franciscus..> | 2025-12-10 20:10 | 187K | |
![[IMG]](/icons/image2.gif) | Neumann, Theodor Alb..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Niehaus, Kasper 29 o..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Niemeijer, Meindert ..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Nierstrasz, Hugo Fre..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Niet, Hein van der ..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Nieuwenhuijs, Consta..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Nijgh, Henricus 14 o..> | 2025-12-10 20:10 | 187K | |
![[IMG]](/icons/image2.gif) | Nolet (de Brauwere v..> | 2025-12-10 20:10 | 186K | |
![[IMG]](/icons/image2.gif) | Nolte, Maria Elisabe..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Noordhoek Hegt, Alex..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Noordmans, Oepke 18 ..> | 2025-12-10 20:10 | 127K | |
![[IMG]](/icons/image2.gif) | Noppen, Marinus Corn..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Norel, Klaas 9 nove..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Noske, Abraham Antho..> | 2025-12-10 20:10 | 182K | |
![[IMG]](/icons/image2.gif) | Noteboom, Daniël 2..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Oldeboerrigter, Mell..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Oliemans, Anton Piet..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Onclin, Kornelis Joh..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Ooft, Cornelis Desir..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Oorthuijs, Casparus ..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Oosterzee, Jan Woute..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Oosterzee, Johannes ..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Oster, August Wilhel..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Ott, Gerrit Leopoldu..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Otten, Johannes Fran..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Otten, Johannes Fran..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Ouborg, Pieter 10 ma..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Oud, Hendrik Emile ..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Oudegeest, Carolina ..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Ouden, Marinus Petru..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Oudendijk, Willem Ja..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Oversloot, Maria Pet..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Paap, Wouter Ernst ..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Paauwe, Bastiaan Jac..> | 2025-12-10 20:10 | 187K | |
![[IMG]](/icons/image2.gif) | Palingdood, Adriana ..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Pant, Theresia Reini..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Pengel, Johan Adolf ..> | 2025-12-10 20:10 | 187K | |
![[IMG]](/icons/image2.gif) | Penning, Willem Levi..> | 2025-12-10 20:10 | 182K | |
![[IMG]](/icons/image2.gif) | Peters, Willem 5 ju..> | 2025-12-10 20:10 | 284K | |
![[IMG]](/icons/image2.gif) | Petie, Theodora 23 j..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Petri, Wilhelm 7 jan..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Peursen, Cornelis An..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Philips, Frederik Ja..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Pieck , Anton Franci..> | 2025-12-10 20:10 | 178K | |
![[IMG]](/icons/image2.gif) | Pieters, Evert 11 de..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Pieters, Ludovicus J..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Pijfers, Hermanus Jo..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Pijper, Fredrik 9-1-..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Plas, Adrianus Marie..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Ploeg, Johannes Gijs..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Ploeg, Johannes Petr..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Poels, Jan 21 maart ..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Pol, Pieter Jacobus ..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Polak Kerdijk, Arnol..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Polak, Carel Hendrik..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Polak, Nico Jacob 18..> | 2025-12-10 20:10 | 184K | |
![[IMG]](/icons/image2.gif) | Polanen, Jean-fils D..> | 2025-12-10 20:10 | 212K | |
![[IMG]](/icons/image2.gif) | Pons, Vries 19 juli ..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Poortenaar, Jan Chri..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Poortinga, Ype 28 me..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Poortman, Johannes J..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Pop, Willem Frederik..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Popken, Jan , 14 dec..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Popma, Jentsje 30 se..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Pos, Coenraad Simon ..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Pos, Hugo 28 novembe..> | 2025-12-10 20:10 | 108K | |
![[IMG]](/icons/image2.gif) | Pos, Raijmond Henri ..> | 2025-12-10 20:10 | 187K | |
![[IMG]](/icons/image2.gif) | Praag, Meijer van 2..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Puchinger, George 1..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Putte, Levinus Abrah..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Raalte, Marinus Juli..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Radhakishun, Harry S..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Radijs, Janna Hendri..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Rambonnet, Jean Jacq..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Redmond, Jeane Sophi..> | 2025-12-10 20:10 | 120K | |
![[IMG]](/icons/image2.gif) | Rees, Catharina Feli..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Rehm, Henri 24 apri..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Reiman, Daniël 30-0..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Reiman, Johannes Dan..> | 2025-12-10 20:10 | 187K | |
![[IMG]](/icons/image2.gif) | Remmelts, Jacobus Jo..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Rens, Just 12 april ..> | 2025-12-10 20:10 | 142K | |
![[IMG]](/icons/image2.gif) | Rens, Lucien Leo Edu..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Reuchlin, Johan Geor..> | 2025-12-10 20:10 | 187K | |
![[IMG]](/icons/image2.gif) | Reuland, Jacob 8 jun..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Reuver, Anna Maria C..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Reve, Karel van het ..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Reys, Susanna Jacoba..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Rhijn, Pieter Johann..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Richters, Bernardus ..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Richters, Marius Joh..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Ridderhof, Matthijs ..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Riel, Harm van 18 fe..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Riemsdijk, Johan Cor..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Rienks, Pieter Hendr..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Rietberg, Helena The..> | 2025-12-10 20:10 | 187K | |
![[IMG]](/icons/image2.gif) | Reynvaan, Johanna Pa..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Rietstap, Johannes B..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Rietveld, Frans 28 d..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Rijckevorsel, Joanne..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Rijen, Adolf Josef H..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Rijfkogel, Albertine..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Rijk, Ester van 29 ..> | 2025-12-10 20:10 | 181K | |
![[IMG]](/icons/image2.gif) | Rijk, Ester van 29-7..> | 2025-12-10 20:10 | 187K | |
![[IMG]](/icons/image2.gif) | Rijkens, Paul Carl 1..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Rijlaarsdam, Jan 2-3..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Rijneke, Jacoba Wilh..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Rijnhout, Rigardus 2..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Rijnsdorp, Cornelis ..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Rijssen, Johanna Rei..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Rikken, Henri Franç..> | 2025-12-10 20:10 | 139K | |
![[IMG]](/icons/image2.gif) | Rink, Paulus Philipp..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Rip, Willem Cornelis..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Ritmeester, Govert 2..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Ritter, Pierre Henri..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Robbers, Herman Joha..> | 2025-12-10 20:10 | 159K | |
![[IMG]](/icons/image2.gif) | Robbers, Jacobus Geo..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Robbers, Johann Gott..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Robbert van 't Hoff ..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Rochussen, Charles 1..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Rodenbach, Albertus ..> | 2025-12-10 20:10 | 182K | |
![[IMG]](/icons/image2.gif) | Rodenko, Paul Thomas..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Rodrigues, Flora 3-9..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Roelofs, Willem 10 m..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Roelofsz, Marie Anto..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Rogge, Elisabeth Mar..> | 2025-12-10 20:10 | 185K | |
![[IMG]](/icons/image2.gif) | Roggeveen, Leonard 2..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Rogier, Ludovicus Ja..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Roijen , Berend van ..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Roijer, Georg 19 mei..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Roldanus, Cornelia W..> | 2025-12-10 20:10 | 182K | |
![[IMG]](/icons/image2.gif) | Rombach, Carel Anton..> | 2025-12-10 20:10 | 185K | |
![[IMG]](/icons/image2.gif) | Rooij, Charles Joan ..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Roos, Henderina 3-..> | 2025-12-10 20:10 | 313K | |
![[IMG]](/icons/image2.gif) | Roos, Henderina 3-10..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Roovers, Petrus Hend..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Roozendaal, Rosalie ..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Rop, Antonius Leonar..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Roskam, Evert Jan 22..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Rossum, Wilhelmus Ma..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Rost van Tonningen, ..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Roszbach, Jacob Pete..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Rueb, Gerharda Johan..> | 2025-12-10 20:10 | 183K | |
![[IMG]](/icons/image2.gif) | Ruijs, Anna Charlott..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Ruijs, Frits Rudolf ..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Ruijs, Henri Guillau..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Ruijs, Theodorus Adr..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Ruijs, Willem 25 aug..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Ruiter, Lodewijk Joh..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Ruitman, Willemina C..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Ruler, Arnold Albert..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Rust, Johan Adolph 1..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Rutgers, Jacqueline ..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Ruys, Wilhelmina Jac..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Röling, Bernardus V..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Röling, Gerard Vict..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Röling, Gerardus 22..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Sablairolles, HenriÃ..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Römelingh, Geertrui..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Sablairolles, Johann..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Sablairolles, Suzann..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Sablairolles, Theodo..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Sablairolles, Wilhel..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Sandbergen, Louise A..> | 2025-12-10 20:10 | 181K | |
![[IMG]](/icons/image2.gif) | Sanders, Leendert Jo..> | 2025-12-10 20:10 | 185K | |
![[IMG]](/icons/image2.gif) | Sandick, Anna van 30..> | 2025-12-10 20:10 | 187K | |
![[IMG]](/icons/image2.gif) | Sandt, Cornelis Chri..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Sant, François van ..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Santen Kolff, Jacob ..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Santen, Joseph van 7..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Santman, Frank 18 de..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Saris, Helena Barbar..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Sarton, George Alfre..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Sas, Gijsbertus Jaco..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Sax, Angelique Antoi..> | 2025-12-10 20:10 | 182K | |
![[IMG]](/icons/image2.gif) | Sax, Nicolaas 15 nov..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Schaaf, Trijntje van..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Schaepman, Andreas I..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Schaft, Jannetje Joh..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Schaïk, David Corne..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Scheidius, Adriana J..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Schelfhout, Lodewijk..> | 2025-12-10 20:10 | 153K | |
![[IMG]](/icons/image2.gif) | Schenk, Magdalena Ge..> | 2025-12-10 20:10 | 187K | |
![[IMG]](/icons/image2.gif) | Schevichaven , Jakob..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Schilfgaarde, Johann..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Schilt, Martinus 29 ..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Schipaanboord, Gerri..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Schipperus, Pieter A..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Schmelzer, Wilhelm K..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Schmidt Degener, Fri..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Schmidt, Anna Maria ..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Schoonenberg, Petrus..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Schoonhoven, Johanne..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Schootemeijer, Gerri..> | 2025-12-10 20:10 | 315K | |
![[IMG]](/icons/image2.gif) | Schotel, Jan 21 janu..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Schuchart, Max 16 a..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Schuh, Frederik 7 fe..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Schuil, Jouke Broer ..> | 2025-12-10 20:10 | 187K | |
![[IMG]](/icons/image2.gif) | Schuil, Martinus 26 ..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Schuitenvoerder, Dui..> | 2025-12-10 20:10 | 320K | |
![[IMG]](/icons/image2.gif) | Schulte Nordholt, He..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Schulte Nordholt, He..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Schotel, Andreas 20-..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Schulte Nordholt, Ja..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Schultink, Hendrik 3..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Schwagermann, Danië..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Schäfer, Dirk 25 n..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Selms, Adrianus van ..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Senff, Dina Willemin..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Servais, Adrien Fran..> | 2025-12-10 20:10 | 177K | |
![[IMG]](/icons/image2.gif) | Servais, Frédéric ..> | 2025-12-10 20:10 | 186K | |
![[IMG]](/icons/image2.gif) | Sichterman, Mello 10..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Siegenbeek van Heuke..> | 2025-12-10 20:10 | 185K | |
![[IMG]](/icons/image2.gif) | Sijmons, Barend 18 ..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Sijthoff, Hendrik Al..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Sirks, Adriaan Hendr..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Sirks, Jan 23 februa..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Slavenburg, Cornelis..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Sligcher, Maria Suza..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Slok, Lambertus 21 a..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Slok, Maria Elisabet..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Sloot, Jan van der ..> | 2025-12-10 20:10 | 186K | |
![[IMG]](/icons/image2.gif) | Slotemaker de Bruïn..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Slotemaker de Bruïn..> | 2025-12-10 20:10 | 185K | |
![[IMG]](/icons/image2.gif) | Sluis, Charles Pierr..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Sluiter, Jan Willem ..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Smeding, Aaltje 17 j..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Smit, Andries 30 jun..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Smit, Arij 7 juli 19..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Smith, Anthonie Wout..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Smits, Hendrik Jan C..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Smits, Joukje 17 apr..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Snelleman, Johannes ..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Snickers, Pieter Mat..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Snijders, Maria Dina..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Snoek, Aart 15 septe..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Sonneveld, Willem 28..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Soudijn, Petrus Mari..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Soutberg, Elisabeth ..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Smits, Jacobus Johan..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Spalburg, Johan Geor..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Spanjaard, Rozina 5 ..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Speenhoff, Cesarina ..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Speenhoff, Jacobus H..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Speijer, Rosette 29-..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Spoel, Hendrk Marinu..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Spronsen, Karel Corn..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Staal, Hendrik Peter..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Stieltjes, Thomas Je..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Stieltjes, Thomas Jo..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Stip, Cornelis Jan 2..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Stoep, Marinus van d..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Stolk Corneliszoon, ..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Stolk, Abraham van 1..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Stolk, Anna Joanna v..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Stomps, Magdalena Al..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Stratenus, Louise An..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Strijd, Krijn 18 sep..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Stroink, Julia 24-1-..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Stroink, Nora Franci..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Stroman, Bernard Joh..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Stronck, Richard 20 ..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Stroucken, Jacobus V..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Struik, Dirk Jan 30 ..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Struik, Jantje Corne..> | 2025-12-10 20:10 | 135K | |
![[IMG]](/icons/image2.gif) | Struik, Thomas Anton..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Stuivenberg, Pieter ..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Stuurop, Hendrik Wi..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Stuyt, Johannes 21 a..> | 2025-12-10 20:10 | 186K | |
![[IMG]](/icons/image2.gif) | Sunier, Armand Louis..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Swaab, Reintje 16-1-..> | 2025-12-10 20:10 | 317K | |
![[IMG]](/icons/image2.gif) | Swart, Corstiaan Hen..> | 2025-12-10 20:10 | 314K | |
![[IMG]](/icons/image2.gif) | Swart, Elisabeth Sar..> | 2025-12-10 20:10 | 315K | |
![[IMG]](/icons/image2.gif) | Swarth, Stephanie HÃ..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Sötemann, August La..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Taconis, Krijn Hendr..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Taconis, Thijs 28 ma..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Tak, Andries 29 sept..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Tak, Christiaan Boni..> | 2025-12-10 20:10 | 181K | |
![[IMG]](/icons/image2.gif) | Tak, Christiaan Boni..> | 2025-12-10 20:10 | 183K | |
![[IMG]](/icons/image2.gif) | Tammens, Sietje 29-7..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Tammes, Jantina 23-6..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Tas, Eva 7-8-1915 22..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Tas, Louis Mattithja..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Teding van Berkhout,..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Teixeira de Mattos, ..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Tellegen, Jan Willem..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Tellegen, Marie Anne..> | 2025-12-10 20:10 | 186K | |
![[IMG]](/icons/image2.gif) | Temme, Hendrik Lodew..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Terruwe, Anna Alberd..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Tertholen, Sara Mari..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Terwindt, Beatrice W..> | 2025-12-10 20:10 | 187K | |
![[IMG]](/icons/image2.gif) | Terwisga, Meinarda M..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Thijm, Ludwig Ernest..> | 2025-12-10 20:10 | 145K | |
![[IMG]](/icons/image2.gif) | Thijssen, Adèle Fra..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Thoden van Velzen, H..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Thomassen, Willem 3 ..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Thors, Alexander Fre..> | 2025-12-10 20:10 | 186K | |
![[IMG]](/icons/image2.gif) | Thöenes, Piet 26 au..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Tibbe, Hendrik 7 aug..> | 2025-12-10 20:10 | 187K | |
![[IMG]](/icons/image2.gif) | Tibbe, Henri 27 mei..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Tibbe, Marie Corneli..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Tilanus, Jan Willem ..> | 2025-12-10 20:10 | 186K | |
![[IMG]](/icons/image2.gif) | Tilanus, Liede 30-3-..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Tillema, Jan Albert ..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Timmermans , Anna Pe..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Tobbe, Anna Maria 24..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Tonneyck, René Pier..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Toom, Willem den 11..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Toonder, Marten sr 1..> | 2025-12-10 20:10 | 252K | |
![[IMG]](/icons/image2.gif) | Tours, Bartholomeus ..> | 2025-12-10 20:10 | 186K | |
![[IMG]](/icons/image2.gif) | Touwen, Lourens 22-0..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Traa, Cornelis van 1..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Triesman, Wilhelmina..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Trimbos, Cornelis Jo..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Trirum, Simon Arij v..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Trompetter, Betsij H..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Turk, Wilhelmina den..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Turksma, Hulda Elisa..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Ubbink, Johan Bernar..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Uden, Catharina Mari..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Uden, Johanna Helena..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Uhlenbeck, Eugenius ..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Uildriks, Frederica ..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Uittenbogaard, Leona..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Ullman, Geertruida M..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Unger, Balth Hendrik..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Vaart, Adrianus van ..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Valckenier Kips, Jan..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Valkenburg, Adriana ..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Valkhoff, Jacobus 1..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Vaz Dias, Mozes 22 ..> | 2025-12-10 20:10 | 187K | |
![[IMG]](/icons/image2.gif) | Vecht, Roosje 18-7-1..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Vecht, Rosa 3 februa..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Veen, Maria van 11 f..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Veer, Eduard Jules v..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Velde, Abraham Gerar..> | 2025-12-10 20:10 | 186K | |
![[IMG]](/icons/image2.gif) | Velde, Gerardus van ..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Velden, Petrus Ignat..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Veldstra, Uilkjen 22..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Velleman, Michel 5 ..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Velleman, Sara (Selm..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Velzen, Anna Maria A..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Ven, Philip Corneliu..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Venema, Reintje 3 ja..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Vening Meinesz, Feli..> | 2025-12-10 20:10 | 183K | |
![[IMG]](/icons/image2.gif) | Vente, Leendert Roel..> | 2025-12-10 20:10 | 182K | |
![[IMG]](/icons/image2.gif) | Verbon, Willem Adolf..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Verdenius, Martha Ca..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Verhagen, Henrica Jo..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Verhallen, Johanna M..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Verheul, Jan 14 feb..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Verhey, Theodorus He..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Verhulst, Johannes J..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Verkade, Pieter Edua..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Verkuijl, Johannes 1..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Vermaat, Willemina 1..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Verolme, Cornelis 4 ..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Verschoor, Anna Soph..> | 2025-12-10 20:10 | 158K | |
![[IMG]](/icons/image2.gif) | Verschuer, Jacoba Al..> | 2025-12-10 20:10 | 185K | |
![[IMG]](/icons/image2.gif) | Versluijs, Elizabeth..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Versprille, Anna Joh..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Versteegh, Theodora ..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Vessem, Anton Johan ..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Veth, Bastiaan 12 ma..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Visscher, Jacobina B..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Visscher, Rinskje 10..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Visser, Clara Wilhel..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Visser, Cornelia Eli..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Visser, Ernst Lodewi..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Visser, Gerarda Alid..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Visser, Johannes Ant..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Visser, Lodewijk Ern..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Visser, Pieter 2 okt..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Vladeracken, Geertru..> | 2025-12-10 20:10 | 186K | |
![[IMG]](/icons/image2.gif) | Vlasblom, Louwrens C..> | 2025-12-10 20:10 | 186K | |
![[IMG]](/icons/image2.gif) | Vleugels, Gerardus 3..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Vlies, Anke van der ..> | 2025-12-10 20:10 | 186K | |
![[IMG]](/icons/image2.gif) | Vlis, Cornelia Johan..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Vlugt, Leendert Corn..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Voet, Jeannette 20-4..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Voeten, Emilius Petr..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Vogel, Cornelia Joha..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Vogel, Ellen Marie E..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Vogel, Jan Frederik ..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Vogel, Jean Philippe..> | 2025-12-10 20:10 | 187K | |
![[IMG]](/icons/image2.gif) | Vogel, Nicolaas Corn..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Vollenhoven, Joost v..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Vollenhoven, Joost v..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Vollenhoven, Joost v..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Vonk, Johanna Christ..> | 2025-12-10 20:10 | 187K | |
![[IMG]](/icons/image2.gif) | Voorden, August Will..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Voorhoeve, Ernst 27 ..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Voorst tot Voorst jr..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Voorst tot Voorst, A..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Voort, Johanna Catha..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Voorthuijzen, Louwre..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Vorkink, Alberta Hen..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Vorrink, Irene 7-1-1..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Vorrink, Jacobus Jan..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Vos Van Steenwijk, A..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Vos, Anna Catharina ..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Vos, Anna Catharina ..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Vos, Grietje 10-11-1..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Vos, Maria 21-12-182..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Vos, Maria Wilhelmin..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Vos, Roosje 15-8-186..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Vos, Selma 10-1-1921..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Voskuijl, Elisabeth ..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Voskuijl, Johannes H..> | 2025-12-10 20:10 | 185K | |
![[IMG]](/icons/image2.gif) | Voûte, Henriëtte 1..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Vrauwdeunt, Hermanus..> | 2025-12-10 20:10 | 183K | |
![[IMG]](/icons/image2.gif) | Vries, Clara Johanna..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Vries, Egbertje de 2..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Vries, Elisabeth de ..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Vries, Henry Lucien ..> | 2025-12-10 20:10 | 118K | |
![[IMG]](/icons/image2.gif) | Vries, Jan Cornelis ..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Vries, Levie de 6 ja..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Vroman, Jaap 21 mei ..> | 2025-12-10 20:10 | 186K | |
![[IMG]](/icons/image2.gif) | Vroman, Leo 10 April..> | 2025-12-10 20:10 | 184K | |
![[IMG]](/icons/image2.gif) | Vroman, Samuel Jacob..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Vroomans, Elizabeth ..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Vrugt, Johanna Petro..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Vuijk, Elizabeth 11-..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Waagenaar, Samuel 10..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Waal, Anna de 25-11-..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Waals, Jacqueline El..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Wagenaar, Gerben 27 ..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Walkate, George Chri..> | 2025-12-10 20:10 | 178K | |
![[IMG]](/icons/image2.gif) | Walraven, Willem 7-6..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Walvisch, Klaartje 6..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Walré de Bordes, Ja..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Wannée, Cornelia Jo..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Warners, Adriana 3-8..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Weijand, Vincent 31 ..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Weijns, Jan Harm 6 d..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Weinthal, Adeleida 9..> | 2025-12-10 20:10 | 187K | |
![[IMG]](/icons/image2.gif) | Wely, Davina van 12-..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Wenckebach, Ludwig O..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Werkman, Sophia Gerh..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Werumeus Buning, Joh..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Westerik, Jacobus 2..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Weyand, Jacob Gerrit..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Wiegersma, Jakob 6 m..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Wiessing, Henri Pier..> | 2025-12-10 20:10 | 186K | |
![[IMG]](/icons/image2.gif) | Wijdenes, Pieter 22 ..> | 2025-12-10 20:10 | 187K | |
![[IMG]](/icons/image2.gif) | Wijnant, Josephus Ge..> | 2025-12-10 20:10 | 187K | |
![[IMG]](/icons/image2.gif) | Wijnberg , Hans 29 n..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Wijnberg, Abraham 29..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Wijnberg, Jehuda Lev..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Wijnberg, Louis 29 n..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Wijngaarde, Edwin Gu..> | 2025-12-10 20:10 | 156K | |
![[IMG]](/icons/image2.gif) | Wijsman, Lina Maria ..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Wilkes, Servaas 13 ..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Wilking, Paul Anton ..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Willebois, Petrus Jo..> | 2025-12-10 20:10 | 185K | |
![[IMG]](/icons/image2.gif) | Willing, Jeanne Gabr..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Wilma Henriëtte Joh..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Winter, Johanna Augu..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Wit, Jan 7 July 1914..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Withuis, Berend Jan ..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Witstein, Sonja Fort..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Witteveen, Maria Zwa..> | 2025-12-10 20:10 | 177K | |
![[IMG]](/icons/image2.gif) | Witteveen, Willem Ge..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Wolf, Ellen Warda Su..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Woude, Johanna Josin..> | 2025-12-10 20:10 | 315K | |
![[IMG]](/icons/image2.gif) | Wttewaall van Stoetw..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Wttewaall van Stoetw..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | wytske-van-dijk-mein..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Xhofleer, Anna Johan..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Ysselsteijn, Gerardi..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Zaalborn, Louis Alex..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Zaanen, Adriaan Corn..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Zanten, Wijntje Corn..> | 2025-12-10 20:10 | 180K | |
![[IMG]](/icons/image2.gif) | Zee, Daniël van der..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Zeehuisen, Johanna 0..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Zeelenberg, Jannetje..> | 2025-12-10 20:10 | 191K | |
![[IMG]](/icons/image2.gif) | Zeeuw, Arie Bastiaan..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Zeeuw, Christina Ann..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Zeeuw, Floris de 13 ..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Zeeuw, Francina de 1..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Zeggelen, Maria Chri..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Zeijde, Marie Helene..> | 2025-12-10 20:10 | 187K | |
![[IMG]](/icons/image2.gif) | Zeijst, Anna Maria E..> | 2025-12-10 20:10 | 189K | |
![[IMG]](/icons/image2.gif) | Zelfde, Janna Johann..> | 2025-12-10 20:10 | 184K | |
![[IMG]](/icons/image2.gif) | Zijlmans, Marinus 2..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Zijlstra, Willemina ..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Zikken, Zwanij 21-9-..> | 2025-12-10 20:10 | 178K | |
![[IMG]](/icons/image2.gif) | Zinsmeister, August ..> | 2025-12-10 20:10 | 187K | |
![[IMG]](/icons/image2.gif) | Zondag, Lammertje 12..> | 2025-12-10 20:10 | 190K | |
![[IMG]](/icons/image2.gif) | Zuijdervelt, Adrianu..> | 2025-12-10 20:10 | 188K | |
![[IMG]](/icons/image2.gif) | Zwiers, Pieter Roelo..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Zwiers, Pieter Roelo..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Zwiers, Willem 17 me..> | 2025-12-10 20:10 | 192K | |
![[IMG]](/icons/image2.gif) | Gouw, Johannes ter 1..> | 2025-12-14 16:44 | 189K | |
![[IMG]](/icons/image2.gif) | Heijse, Jan 1882 16-..> | 2025-12-14 16:44 | 191K | |
![[IMG]](/icons/image2.gif) | Kimpe, Raymundus Jos..> | 2025-12-14 16:44 | 189K | |
![[IMG]](/icons/image2.gif) | Moerman, Jacob Diede..> | 2025-12-14 16:44 | 188K | |
![[IMG]](/icons/image2.gif) | Moeskops, Pieter Dan..> | 2025-12-14 16:44 | 190K | |
![[IMG]](/icons/image2.gif) | Mok, Salomon 12-12-..> | 2025-12-14 16:44 | 189K | |
![[IMG]](/icons/image2.gif) | Mol, Jan Cornelis 17..> | 2025-12-14 16:44 | 190K | |
![[IMG]](/icons/image2.gif) | Molenaar, Albert de ..> | 2025-12-14 16:44 | 188K | |
![[IMG]](/icons/image2.gif) | Molenaar, Anthonie N..> | 2025-12-14 16:44 | 188K | |
![[IMG]](/icons/image2.gif) | Molenaar, Nicolaas 3..> | 2025-12-14 16:44 | 190K | |
![[IMG]](/icons/image2.gif) | Moes, Ernst Wilhelm ..> | 2025-12-14 16:44 | 189K | |
![[IMG]](/icons/image2.gif) | Moll, Willem Jan Hen..> | 2025-12-14 16:44 | 186K | |
![[IMG]](/icons/image2.gif) | Molster, Frederik Ad..> | 2025-12-14 16:44 | 191K | |
![[IMG]](/icons/image2.gif) | Monchy, Willem Hugo ..> | 2025-12-14 16:44 | 192K | |
![[IMG]](/icons/image2.gif) | Monté Verloren, Joh..> | 2025-12-14 16:44 | 191K | |
![[IMG]](/icons/image2.gif) | Moorman, Henricus Co..> | 2025-12-14 16:44 | 192K | |
![[IMG]](/icons/image2.gif) | Moors, Petrus Joanne..> | 2025-12-14 16:44 | 183K | |
![[IMG]](/icons/image2.gif) | Moppes, Willem Maria..> | 2025-12-14 16:44 | 190K | |
![[IMG]](/icons/image2.gif) | Mouton , Willem Anne..> | 2025-12-14 16:44 | 190K | |
![[IMG]](/icons/image2.gif) | Möller, Hendrik Wil..> | 2025-12-14 16:44 | 192K | |
![[IMG]](/icons/image2.gif) | Middelhuis, Johannes..> | 2025-12-14 16:44 | 190K | |
![[IMG]](/icons/image2.gif) | Mijnssen, François ..> | 2025-12-14 16:44 | 190K | |
![[IMG]](/icons/image2.gif) | Milo, Taco Hayo 1-5..> | 2025-12-14 16:44 | 191K | |
![[IMG]](/icons/image2.gif) | Minderhoud, Abraham ..> | 2025-12-14 16:44 | 189K | |
![[IMG]](/icons/image2.gif) | Baudet, Ernest Henri..> | 2025-12-17 13:25 | 191K | |
![[IMG]](/icons/image2.gif) | Baudet, Pierre Josep..> | 2025-12-17 13:25 | 188K | |
![[IMG]](/icons/image2.gif) | Melchers, Gerrit Wil..> | 2025-12-17 13:25 | 191K | |
![[IMG]](/icons/image2.gif) | Melvil baron Van Lij..> | 2025-12-17 13:25 | 188K | |
![[IMG]](/icons/image2.gif) | Mendes da Costa, Jos..> | 2025-12-17 13:25 | 188K | |
![[IMG]](/icons/image2.gif) | Mensing, Antonius Wi..> | 2025-12-17 13:25 | 192K | |
![[IMG]](/icons/image2.gif) | Messchaert, Johannes..> | 2025-12-17 13:25 | 191K | |
![[IMG]](/icons/image2.gif) | Mesu, Ferdinandus Pi..> | 2025-12-17 13:25 | 185K | |
![[IMG]](/icons/image2.gif) | Meulen, Carel Eliza ..> | 2025-12-17 13:25 | 190K | |
![[IMG]](/icons/image2.gif) | Meulen, Henri ter 30..> | 2025-12-17 13:25 | 191K | |
![[IMG]](/icons/image2.gif) | Meurs, Johan Hendrik..> | 2025-12-17 13:25 | 191K | |
![[IMG]](/icons/image2.gif) | Michels, Antonius Ma..> | 2025-12-17 13:25 | 191K | |
![[IMG]](/icons/image2.gif) | Michels, Leonardus C..> | 2025-12-17 13:25 | 188K | |
![[IMG]](/icons/image2.gif) | Michiels van Verduij..> | 2025-12-17 13:25 | 184K | |
![[IMG]](/icons/image2.gif) | Mönnich, Conrad Wil..> | 2025-12-17 13:25 | 188K | |
![[IMG]](/icons/image2.gif) | Noort, Gerardus Corn..> | 2025-12-17 13:25 | 191K | |
![[IMG]](/icons/image2.gif) | Noyon, Tarquinius Jo..> | 2025-12-17 13:25 | 186K | |
![[IMG]](/icons/image2.gif) | Naber, Henri Adrien ..> | 2025-12-20 00:58 | 189K | |
![[IMG]](/icons/image2.gif) | Naber, Jean Charles ..> | 2025-12-20 00:58 | 190K | |
![[IMG]](/icons/image2.gif) | Naber, Samuel Adrian..> | 2025-12-20 00:58 | 189K | |
![[IMG]](/icons/image2.gif) | Nieuwenkamp, Wijnand..> | 2025-12-20 00:58 | 192K | |
![[IMG]](/icons/image2.gif) | Nieuwenkamp, Willem ..> | 2025-12-20 00:58 | 190K | |
![[IMG]](/icons/image2.gif) | Nolens, Willem Huber..> | 2025-12-20 00:58 | 188K | |
![[IMG]](/icons/image2.gif) | Nolet, Willem 28-9-..> | 2025-12-20 00:58 | 192K | |
![[IMG]](/icons/image2.gif) | Nolst Trenité, Anto..> | 2025-12-20 00:58 | 191K | |
![[IMG]](/icons/image2.gif) | Nolst Trenité, Anto..> | 2025-12-20 00:58 | 189K | |
![[IMG]](/icons/image2.gif) | Nord, Charles Freder..> | 2025-12-20 00:58 | 187K | |
![[IMG]](/icons/image2.gif) | Prinsen, Claudius An..> | 2025-12-20 00:58 | 191K | |
![[IMG]](/icons/image2.gif) | Nagtglas Versteeg, C..> | 2025-12-21 18:13 | 192K | |
![[IMG]](/icons/image2.gif) | Nak, Pieter Frederik..> | 2025-12-21 18:13 | 189K | |
![[IMG]](/icons/image2.gif) | Nederbragt, Johan Al..> | 2025-12-21 18:13 | 191K | |
![[IMG]](/icons/image2.gif) | Nederhorst, Gerard M..> | 2025-12-21 18:13 | 190K | |
![[IMG]](/icons/image2.gif) | Nicolas, Josephus An..> | 2025-12-21 18:13 | 192K | |
![[IMG]](/icons/image2.gif) | Niermeijer, Jan Fred..> | 2025-12-21 18:13 | 185K | |
![[IMG]](/icons/image2.gif) | Nierman, Pieter Anto..> | 2025-12-21 18:13 | 192K | |
![[IMG]](/icons/image2.gif) | Nierop, Arij van 12-..> | 2025-12-21 18:13 | 188K | |
![[IMG]](/icons/image2.gif) | Nierstrasz, Nicolaas..> | 2025-12-21 18:13 | 189K | |
![[IMG]](/icons/image2.gif) | Niet, Hein van der 3..> | 2025-12-21 18:13 | 188K | |
![[IMG]](/icons/image2.gif) | Nobel, Felix de 27-..> | 2025-12-21 18:13 | 190K | |
![[IMG]](/icons/image2.gif) | Nijgh, Henricus Paul..> | 2025-12-21 18:13 | 191K | |
![[IMG]](/icons/image2.gif) | Nobel, Otto Willem d..> | 2025-12-21 18:13 | 191K | |
![[IMG]](/icons/image2.gif) | Oijen, Ludolph Hendr..> | 2025-12-21 18:13 | 187K | |
![[IMG]](/icons/image2.gif) | Otterloo, Jan Willia..> | 2025-12-21 18:13 | 834K | |
![[IMG]](/icons/image2.gif) | Overdiep, Gerrit Sie..> | 2025-12-21 18:13 | 189K | |
![[IMG]](/icons/image2.gif) | Ozinga, Murk Daniël..> | 2025-12-21 18:13 | 188K | |
![[IMG]](/icons/image2.gif) | Scheltema, Jan Hendr..> | 2025-12-21 18:13 | 190K | |
![[IMG]](/icons/image2.gif) | Obreen, Henri Guilla..> | 2025-12-24 13:50 | 186K | |
![[IMG]](/icons/image2.gif) | Oijevaar, Jan Johan ..> | 2025-12-24 13:50 | 191K | |
![[IMG]](/icons/image2.gif) | Okma, Nicolaas 24-12..> | 2025-12-24 13:50 | 188K | |
![[IMG]](/icons/image2.gif) | Oorschot, Antonius L..> | 2025-12-24 13:50 | 191K | |
![[IMG]](/icons/image2.gif) | Oppenheim, Jacques (..> | 2025-12-24 13:50 | 190K | |
![[IMG]](/icons/image2.gif) | Orelio, Joseph Marie..> | 2025-12-24 13:50 | 190K | |
![[IMG]](/icons/image2.gif) | Oss, Salomon Frederi..> | 2025-12-24 13:50 | 191K | |
![[IMG]](/icons/image2.gif) | Ouwehand, Cornelis W..> | 2025-12-24 13:50 | 188K | |
![[IMG]](/icons/image2.gif) | Oven, Julius Christi..> | 2025-12-24 13:50 | 189K | |
![[IMG]](/icons/image2.gif) | Posthumus, Nicolaas ..> | 2025-12-24 13:50 | 189K | |
![[IMG]](/icons/image2.gif) | Postma, Obe 29-3-186..> | 2025-12-24 13:50 | 191K | |
![[IMG]](/icons/image2.gif) | Praag, Jonas Andries..> | 2025-12-24 13:50 | 191K | |
![[IMG]](/icons/image2.gif) | Premsela, Benedictus..> | 2025-12-24 13:50 | 191K | |
![[IMG]](/icons/image2.gif) | Premsela, Benno 4 me..> | 2025-12-24 13:50 | 188K | |
![[IMG]](/icons/image2.gif) | Prins, Arij 19-3-18..> | 2025-12-24 13:50 | 191K | |
![[IMG]](/icons/image2.gif) | Prins, Jan Albert 18..> | 2025-12-24 13:50 | 189K | |
![[IMG]](/icons/image2.gif) | Pulle, August Adriaa..> | 2025-12-24 13:50 | 184K | |
![[IMG]](/icons/image2.gif) | Beuckens, Lipkje 15-..> | 2025-12-25 23:15 | 190K | |
![[IMG]](/icons/image2.gif) | Polak, Eduard 14-6-..> | 2025-12-25 23:15 | 191K | |
![[IMG]](/icons/image2.gif) | Polak, Willem 14-9-..> | 2025-12-25 23:15 | 191K | |
![[IMG]](/icons/image2.gif) | Poll, Maximus Joseph..> | 2025-12-25 23:15 | 188K | |
![[IMG]](/icons/image2.gif) | Poortman, Hugo Anne ..> | 2025-12-25 23:15 | 189K | |
![[IMG]](/icons/image2.gif) | Portielje, Anton Fre..> | 2025-12-25 23:15 | 192K | |
![[IMG]](/icons/image2.gif) | Pos, Hendrik Josephu..> | 2025-12-25 23:15 | 186K | |
![[IMG]](/icons/image2.gif) | Pos, Willij Philip ..> | 2025-12-25 23:15 | 190K | |
![[IMG]](/icons/image2.gif) | Post, Regnerus Richa..> | 2025-12-25 23:15 | 191K | |
![[IMG]](/icons/image2.gif) | Pot, Combertus Wille..> | 2025-12-25 23:15 | 189K | |
![[IMG]](/icons/image2.gif) | Poell, Lambert Johan..> | 2025-12-26 18:19 | 191K | |
![[IMG]](/icons/image2.gif) | Poels, Hendrikus And..> | 2025-12-26 18:19 | 190K | |
![[IMG]](/icons/image2.gif) | Pol, Hermanus Hender..> | 2025-12-26 18:19 | 188K | |
![[IMG]](/icons/image2.gif) | Polak, Abraham 27-6..> | 2025-12-26 18:19 | 90K | |
![[IMG]](/icons/image2.gif) | Polak, Benjamin Sall..> | 2025-12-26 18:19 | 87K | |
![[IMG]](/icons/image2.gif) | Polman, Antonius Joh..> | 2025-12-26 18:19 | 91K | |
![[IMG]](/icons/image2.gif) | Perk, Christina Eliz..> | 2025-12-28 23:51 | 187K | |
![[IMG]](/icons/image2.gif) | Perquin, Lambertus H..> | 2025-12-28 23:51 | 191K | |
![[IMG]](/icons/image2.gif) | Peters, Cornelis Hen..> | 2025-12-28 23:51 | 189K | |
![[IMG]](/icons/image2.gif) | Philips, Gerard Leon..> | 2025-12-28 23:51 | 187K | |
![[IMG]](/icons/image2.gif) | Piepers, Marinus Cor..> | 2025-12-28 23:51 | 192K | |
![[IMG]](/icons/image2.gif) | Pijnenborg, Johannes..> | 2025-12-28 23:51 | 191K | |
![[IMG]](/icons/image2.gif) | Pincoffs, Lodewijk ..> | 2025-12-28 23:51 | 191K | |
![[IMG]](/icons/image2.gif) | Pinke, Albertus Samu..> | 2025-12-28 23:51 | 192K | |
![[IMG]](/icons/image2.gif) | Pinto, Oreste 9-10-1..> | 2025-12-28 23:51 | 190K | |
![[IMG]](/icons/image2.gif) | Pit, Adriaan 25-4-1..> | 2025-12-28 23:51 | 190K | |
![[IMG]](/icons/image2.gif) | Pitlo, Adriaan 23-9..> | 2025-12-28 23:51 | 192K | |
![[IMG]](/icons/image2.gif) | Plate, Antoine 26-5-..> | 2025-12-28 23:51 | 187K | |
![[IMG]](/icons/image2.gif) | Plate, Auguste 18-2-..> | 2025-12-28 23:51 | 192K | |
![[IMG]](/icons/image2.gif) | Platteel, Pieter Joh..> | 2025-12-28 23:51 | 190K | |
![[IMG]](/icons/image2.gif) | Plesman, Albert 7-9-..> | 2025-12-28 23:51 | 183K | |
![[IMG]](/icons/image2.gif) | Pleijte, Thomas Bast..> | 2025-12-28 23:51 | 190K | |
![[IMG]](/icons/image2.gif) | Poelhekke, Jan Josep..> | 2025-12-28 23:51 | 189K | |
![[IMG]](/icons/image2.gif) | Poelhekke, Martinus ..> | 2025-12-28 23:51 | 189K | |
![[IMG]](/icons/image2.gif) | Poelje, Gerrit Abrah..> | 2025-12-28 23:51 | 188K | |
![[IMG]](/icons/image2.gif) | Paap, Willem Anthoni..> | 2025-12-29 19:09 | 254K | |
![[IMG]](/icons/image2.gif) | Pabst, Jean Charles ..> | 2025-12-29 19:09 | 254K | |
![[IMG]](/icons/image2.gif) | Pala, Peter Karel Hu..> | 2025-12-29 19:09 | 191K | |
![[IMG]](/icons/image2.gif) | Stheeman, Eisso Post..> | 2025-12-29 19:09 | 248K | |
![[IMG]](/icons/image2.gif) | Pahud de Mortanges, ..> | 2025-12-31 00:45 | 181K | |
![[IMG]](/icons/image2.gif) | Panhuijs, Haro Frede..> | 2025-12-31 00:45 | 189K | |
![[IMG]](/icons/image2.gif) | Parmentier, Koene Di..> | 2025-12-31 00:45 | 192K | |
![[IMG]](/icons/image2.gif) | Pater, Jan Cornelis ..> | 2025-12-31 00:45 | 179K | |
![[IMG]](/icons/image2.gif) | Pekelharing, Baltus ..> | 2025-12-31 00:45 | 189K | |
![[IMG]](/icons/image2.gif) | Pelkwijk, Gerhard Ab..> | 2025-12-31 00:45 | 191K | |
![[IMG]](/icons/image2.gif) | Pellenaars, Cornelis..> | 2025-12-31 00:45 | 190K | |
![[IMG]](/icons/image2.gif) | Pelt, Adrianus, Koog..> | 2025-12-31 00:45 | 192K | |
![[IMG]](/icons/image2.gif) | Penning, Louwrens 2..> | 2025-12-31 00:45 | 189K | |
![[IMG]](/icons/image2.gif) | Quanjer, Hendrik Mar..> | 2025-12-31 00:45 | 190K | |
![[IMG]](/icons/image2.gif) | Quack, Hendrick Pete..> | 2025-12-31 00:45 | 186K | |
![[IMG]](/icons/image2.gif) | Quarles van Ufford, ..> | 2025-12-31 00:45 | 188K | |
![[IMG]](/icons/image2.gif) | Querido, Arie 18-1-1..> | 2025-12-31 00:45 | 190K | |
![[IMG]](/icons/image2.gif) | Quint, Willem Henric..> | 2026-01-01 03:32 | 186K | |
![[IMG]](/icons/image2.gif) | Rees, Otto van 4-1-..> | 2026-01-01 03:32 | 189K | |
![[IMG]](/icons/image2.gif) | Reiger, Bernardus 14..> | 2026-01-01 03:32 | 254K | |
![[IMG]](/icons/image2.gif) | Reijmer, Paul Johan ..> | 2026-01-01 03:32 | 1.2M | |
![[IMG]](/icons/image2.gif) | Rhijn, Arie Adriaan ..> | 2026-01-01 03:32 | 189K | |
![[IMG]](/icons/image2.gif) | Riel, Cornelis Gerar..> | 2026-01-01 03:32 | 191K | |
![[IMG]](/icons/image2.gif) | Riemsdijk, Frederik ..> | 2026-01-01 03:32 | 190K | |
![[IMG]](/icons/image2.gif) | Riemsdijk, Theodorus..> | 2026-01-01 03:32 | 190K | |
![[IMG]](/icons/image2.gif) | Rijke, Petrus Leonar..> | 2026-01-01 03:32 | 180K | |
![[IMG]](/icons/image2.gif) | Ringers, Johannes Al..> | 2026-01-01 03:32 | 189K | |
![[IMG]](/icons/image2.gif) | Risseeuw, Pieter Joh..> | 2026-01-01 03:32 | 192K | |
![[IMG]](/icons/image2.gif) | Ritman, Johannes Hen..> | 2026-01-01 03:32 | 191K | |
![[IMG]](/icons/image2.gif) | Raaijmaakers, Marius..> | 2026-01-05 01:24 | 191K | |
![[IMG]](/icons/image2.gif) | Raaijmakers, Charles..> | 2026-01-05 01:24 | 190K | |
![[IMG]](/icons/image2.gif) | Raalte, Albert Bernh..> | 2026-01-05 01:24 | 191K | |
![[IMG]](/icons/image2.gif) | Ramaer, Johan Christ..> | 2026-01-05 01:24 | 192K | |
![[IMG]](/icons/image2.gif) | Rassers, Willem Huib..> | 2026-01-05 01:24 | 190K | |
![[IMG]](/icons/image2.gif) | Ravesteijn, Sijbold ..> | 2026-01-05 01:24 | 191K | |
![[IMG]](/icons/image2.gif) | Ravesteijn, Willem v..> | 2026-01-05 01:24 | 189K | |
![[IMG]](/icons/image2.gif) | Redeke, Heinrich Car..> | 2026-01-05 01:24 | 190K | |
![[IMG]](/icons/image2.gif) | Reesse, Jan Jacob 2..> | 2026-01-05 01:24 | 191K | |
![[IMG]](/icons/image2.gif) | Regout, Edmond Rober..> | 2026-01-05 01:24 | 191K | |
![[IMG]](/icons/image2.gif) | Regout, Louis Hubert..> | 2026-01-05 01:24 | 186K | |
![[IMG]](/icons/image2.gif) | Regout, Robertus Hub..> | 2026-01-05 01:24 | 191K | |
![[IMG]](/icons/image2.gif) | Reinink, Hendrik Jan..> | 2026-01-05 01:24 | 191K | |
![[IMG]](/icons/image2.gif) | Rengelink, Jan Wille..> | 2026-01-05 01:24 | 191K | |
![[IMG]](/icons/image2.gif) | Rengers Hora Siccama..> | 2026-01-05 01:24 | 191K | |
![[IMG]](/icons/image2.gif) | Rengers Hora Siccama..> | 2026-01-05 01:24 | 191K | |
![[IMG]](/icons/image2.gif) | Renier, Gustaaf Joha..> | 2026-01-05 01:24 | 190K | |
![[IMG]](/icons/image2.gif) | Rethaan Macaré, Adr..> | 2026-01-05 01:24 | 189K | |
![[IMG]](/icons/image2.gif) | Reuther, Anthonie Er..> | 2026-01-05 01:24 | 189K | |
![[IMG]](/icons/image2.gif) | Romme, Carl Paul Mar..> | 2026-01-05 01:24 | 255K | |
![[IMG]](/icons/image2.gif) | Rooij, Maarten17-4-1..> | 2026-01-05 01:24 | 187K | |
![[IMG]](/icons/image2.gif) | Rooijackers, Lambert..> | 2026-01-05 01:24 | 190K | |
![[IMG]](/icons/image2.gif) | Roolvink, Bauke 31-1..> | 2026-01-05 01:24 | 191K | |
![[IMG]](/icons/image2.gif) | Roos, Sjoerd de 14-..> | 2026-01-05 01:24 | 190K | |
![[IMG]](/icons/image2.gif) | Ruijgers, Henricus J..> | 2026-01-05 01:24 | 191K | |
![[IMG]](/icons/image2.gif) | Ruijneman, Daniël ..> | 2026-01-05 01:24 | 191K | |
![[IMG]](/icons/image2.gif) | Ruijs, Bernardus Ewo..> | 2026-01-05 01:24 | 191K | |
![[IMG]](/icons/image2.gif) | Ruijs, Bonne 29-7-18..> | 2026-01-05 01:24 | 192K | |
![[IMG]](/icons/image2.gif) | Ruijs, Jacob Adolf ..> | 2026-01-05 01:24 | 191K | |
![[IMG]](/icons/image2.gif) | Ruijs, Willem 15-3-..> | 2026-01-05 01:24 | 192K | |
![[IMG]](/icons/image2.gif) | Ruijter van Stevenin..> | 2026-01-05 01:24 | 191K | |
![[IMG]](/icons/image2.gif) | Ruppert, Marinus 1-..> | 2026-01-05 01:24 | 190K | |
![[IMG]](/icons/image2.gif) | Russel, George Marie..> | 2026-01-05 01:24 | 191K | |
![[IMG]](/icons/image2.gif) | Rutgers, Abraham Arn..> | 2026-01-05 01:24 | 192K | |
![[IMG]](/icons/image2.gif) | Rutten, Franciscus J..> | 2026-01-05 01:24 | 191K | |
![[IMG]](/icons/image2.gif) | Rutten, Louis Martin..> | 2026-01-05 01:24 | 189K | |
![[IMG]](/icons/image2.gif) | Tol, Jacobus Francis..> | 2026-01-05 01:24 | 192K | |
![[IMG]](/icons/image2.gif) | Ruijs de Beerenbrouc..> | 2026-01-05 21:06 | 247K | |
![[IMG]](/icons/image2.gif) | Rückert, Johan Hend..> | 2026-01-05 21:06 | 251K | |
![[IMG]](/icons/image2.gif) | Rüter, Adolf Johann..> | 2026-01-05 21:06 | 247K | |
![[IMG]](/icons/image2.gif) | Roosjen, Anton Berna..> | 2026-01-06 01:44 | 252K | |
![[IMG]](/icons/image2.gif) | Rossum, Joannes Petr..> | 2026-01-06 01:44 | 250K | |
![[IMG]](/icons/image2.gif) | Ruijgers, Gerardus J..> | 2026-01-06 01:44 | 239K | |
![[IMG]](/icons/image2.gif) | Roijaards, Willem Co..> | 2026-01-07 00:13 | 192K | |
![[IMG]](/icons/image2.gif) | Roijen, Jean Franço..> | 2026-01-07 00:13 | 188K | |
![[IMG]](/icons/image2.gif) | Romijn, Gijsbert 10-..> | 2026-01-07 00:13 | 191K | |
![[IMG]](/icons/image2.gif) | Rooseboom, Willem 9..> | 2026-01-07 00:13 | 189K | |
![[IMG]](/icons/image2.gif) | Verschoor, Anna Hele..> | 2026-01-07 00:13 | 121K | |
![[IMG]](/icons/image2.gif) | Groenman, Sjoerd 28..> | 2026-01-09 21:53 | 192K | |
![[IMG]](/icons/image2.gif) | Rochussen, Willem Fr..> | 2026-01-09 21:53 | 188K | |
![[IMG]](/icons/image2.gif) | Roemers, Derk 6-2-19..> | 2026-01-09 21:53 | 188K | |
![[IMG]](/icons/image2.gif) | Roest van Limburg, T..> | 2026-01-09 21:53 | 190K | |
![[IMG]](/icons/image2.gif) | Romburgh, Pieter van..> | 2026-01-09 21:53 | 192K | |
![[IMG]](/icons/image2.gif) | Roos, Jeanne Mariann..> | 2026-01-09 21:53 | 192K | |
![[IMG]](/icons/image2.gif) | Röell, Antonie 21-8..> | 2026-01-09 21:53 | 189K | |
![[IMG]](/icons/image2.gif) | Röell, David Cornel..> | 2026-01-09 21:53 | 191K | |
![[IMG]](/icons/image2.gif) | Röntgen, Frants Edv..> | 2026-01-09 21:53 | 192K | |
![[IMG]](/icons/image2.gif) | Scholten, Gerbert Jo..> | 2026-01-09 21:53 | 190K | |
![[IMG]](/icons/image2.gif) | Scholten, Lubbertus ..> | 2026-01-09 21:53 | 191K | |
![[IMG]](/icons/image2.gif) | Scholten, Paulus 26-..> | 2026-01-09 21:53 | 191K | |
![[IMG]](/icons/image2.gif) | Schouten, Johannes 1..> | 2026-01-09 21:53 | 190K | |
![[IMG]](/icons/image2.gif) | Schrieke, Bertram Jo..> | 2026-01-09 21:53 | 191K | |
![[IMG]](/icons/image2.gif) | Schrijnen, Josephus ..> | 2026-01-09 21:53 | 189K | |
![[IMG]](/icons/image2.gif) | Veldhuyzen van Zante..> | 2026-01-09 21:53 | 187K | |
![[IMG]](/icons/image2.gif) | Pino, Jakob 23-1-190..> | 2026-01-10 23:27 | 191K | |
![[IMG]](/icons/image2.gif) | Rouffaer, Gerret Pie..> | 2026-01-10 23:27 | 192K | |
![[IMG]](/icons/image2.gif) | Scheltema, Foppe Gab..> | 2026-01-10 23:27 | 188K | |
![[IMG]](/icons/image2.gif) | Schelven, Aart Arnou..> | 2026-01-10 23:27 | 188K | |
![[IMG]](/icons/image2.gif) | Schendel, Arthur Fra..> | 2026-01-10 23:27 | 191K | |
![[IMG]](/icons/image2.gif) | Scheurleer, Daniël ..> | 2026-01-10 23:27 | 189K | |
![[IMG]](/icons/image2.gif) | Schilling, Wijbrandu..> | 2026-01-10 23:27 | 127K | |
![[IMG]](/icons/image2.gif) | Schilling, Wijbrandu..> | 2026-01-10 23:27 | 188K | |
![[IMG]](/icons/image2.gif) | Schilthuis, Jan 17-4..> | 2026-01-10 23:27 | 188K | |
![[IMG]](/icons/image2.gif) | Schimmelpenninck van..> | 2026-01-10 23:27 | 190K | |
![[IMG]](/icons/image2.gif) | Schlegel, Gustaaf 3..> | 2026-01-10 23:27 | 189K | |
![[IMG]](/icons/image2.gif) | Schmier, Hyginus Joh..> | 2026-01-10 23:27 | 189K | |
![[IMG]](/icons/image2.gif) | Schneider, Clemens D..> | 2026-01-10 23:27 | 192K | |
![[IMG]](/icons/image2.gif) | Schoenmaekers, Mathi..> | 2026-01-10 23:27 | 190K | |
![[IMG]](/icons/image2.gif) | Schokking, François..> | 2026-01-10 23:27 | 190K | |
![[IMG]](/icons/image2.gif) | Schokking, Jan 10-5-..> | 2026-01-10 23:27 | 189K | |
![[IMG]](/icons/image2.gif) | Schokking, Willem Fr..> | 2026-01-10 23:27 | 191K | |
![[IMG]](/icons/image2.gif) | Schoorl, Nicolaas 19..> | 2026-01-10 23:27 | 191K | |
![[IMG]](/icons/image2.gif) | Schorer, Johan Wille..> | 2026-01-10 23:27 | 188K | |
![[IMG]](/icons/image2.gif) | Onderwijzer, Abraham..> | 2026-01-16 19:28 | 185K | |
![[IMG]](/icons/image2.gif) | Saal, Willem 4-1-18..> | 2026-01-16 19:28 | 190K | |
![[IMG]](/icons/image2.gif) | Sabron, Frederik Hen..> | 2026-01-16 19:28 | 188K | |
![[IMG]](/icons/image2.gif) | Salomons, Anna Maria..> | 2026-01-16 19:28 | 192K | |
![[IMG]](/icons/image2.gif) | Salomonson, Godfried..> | 2026-01-16 19:28 | 189K | |
![[IMG]](/icons/image2.gif) | Sanders, Theodorus 2..> | 2026-01-16 19:28 | 188K | |
![[IMG]](/icons/image2.gif) | Sandick, Andries Adr..> | 2026-01-16 19:28 | 191K | |
![[IMG]](/icons/image2.gif) | Sandick, Joannes Cat..> | 2026-01-16 19:28 | 189K | |
![[IMG]](/icons/image2.gif) | Sandick, Rudolf Adri..> | 2026-01-16 19:28 | 189K | |
![[IMG]](/icons/image2.gif) | Sarlouis, Lodewijk ..> | 2026-01-16 19:28 | 189K | |
![[IMG]](/icons/image2.gif) | Sassen, Emanuel Mari..> | 2026-01-16 19:28 | 188K | |
![[IMG]](/icons/image2.gif) | Savornin Lohman, Cat..> | 2026-01-16 19:28 | 188K | |
![[IMG]](/icons/image2.gif) | Savornin Lohman, Wit..> | 2026-01-16 19:28 | 188K | |
![[IMG]](/icons/image2.gif) | Schaepman, Herman Jo..> | 2026-01-16 19:28 | 255K | |
![[IMG]](/icons/image2.gif) | Schaik, Josephus Rob..> | 2026-01-16 19:28 | 253K | |
![[IMG]](/icons/image2.gif) | Schaper, Heije 8-9-..> | 2026-01-16 19:28 | 254K | |
![[IMG]](/icons/image2.gif) | Schaper, Johan Hendr..> | 2026-01-16 19:28 | 255K | |
![[IMG]](/icons/image2.gif) | Schatte Olivier, Alb..> | 2026-01-16 19:28 | 191K | |
![[IMG]](/icons/image2.gif) | Scheffer, Cornelis F..> | 2026-01-16 19:28 | 244K | |
![[IMG]](/icons/image2.gif) | Scheffer, Johannes 2..> | 2026-01-16 19:28 | 253K | |
![[IMG]](/icons/image2.gif) | Schilperoort, Anne P..> | 2026-01-16 19:28 | 252K | |
![[IMG]](/icons/image2.gif) | Sneller, Zeger Wille..> | 2026-01-16 19:28 | 190K | |
![[IMG]](/icons/image2.gif) | Snijders, Cornelis J..> | 2026-01-16 19:28 | 191K | |
![[IMG]](/icons/image2.gif) | Snoeck Henkemans, Jo..> | 2026-01-16 19:28 | 191K | |
![[IMG]](/icons/image2.gif) | Snouck Hurgronje, Aa..> | 2026-01-16 19:28 | 186K | |
![[IMG]](/icons/image2.gif) | Soetendorp, Jacob 5..> | 2026-01-16 19:28 | 191K | |
![[IMG]](/icons/image2.gif) | Sonnaville, Ludovicu..> | 2026-01-16 19:28 | 188K | |
![[IMG]](/icons/image2.gif) | Sonsbeeck, Willem Ge..> | 2026-01-16 19:28 | 191K | |
![[IMG]](/icons/image2.gif) | Spier, Rozalie 7-11..> | 2026-01-16 19:28 | 191K | |
![[IMG]](/icons/image2.gif) | Walaardt Sacré, Hen..> | 2026-01-16 19:28 | 252K | |
![[IMG]](/icons/image2.gif) | Ernst, Hubertus Corn..> | 2026-01-18 16:21 | 189K | |
![[IMG]](/icons/image2.gif) | Hasper, Hendrik 14 ..> | 2026-01-18 16:21 | 188K | |
![[IMG]](/icons/image2.gif) | Sluijser, Meijer 9-9..> | 2026-01-18 16:21 | 191K | |
![[IMG]](/icons/image2.gif) | Smelik, Evert Louis ..> | 2026-01-18 16:21 | 192K | |
![[IMG]](/icons/image2.gif) | Smeenge, Harm 25-5-..> | 2026-01-18 16:21 | 192K | |
![[IMG]](/icons/image2.gif) | Smid, Jan 13-2-1865 ..> | 2026-01-18 16:21 | 181K | |
![[IMG]](/icons/image2.gif) | Smidt, Hendrik Jan ..> | 2026-01-18 16:21 | 190K | |
![[IMG]](/icons/image2.gif) | Smit, Arie 1-5-1845 ..> | 2026-01-18 16:21 | 187K | |
![[IMG]](/icons/image2.gif) | Smissaert, Henri 6-..> | 2026-01-18 16:21 | 1.8M | |
![[IMG]](/icons/image2.gif) | Smit, Hendrikus Joha..> | 2026-01-18 16:21 | 189K | |
![[IMG]](/icons/image2.gif) | Smit, Jakob 27-1-18..> | 2026-01-18 16:21 | 191K | |
![[IMG]](/icons/image2.gif) | Smits, Josse Antoin ..> | 2026-01-18 16:21 | 190K | |
![[IMG]](/icons/image2.gif) | Smitskamp, Hendrik ..> | 2026-01-18 16:21 | 191K | |
![[IMG]](/icons/image2.gif) | Smulders, Johannes N..> | 2026-01-18 16:21 | 188K | |
![[IMG]](/icons/image2.gif) | Sneevliet, Hendricus..> | 2026-01-18 16:21 | 189K | |
![[IMG]](/icons/image2.gif) | Aa, Jan van der 25-..> | 2026-01-27 22:35 | 191K | |
![[IMG]](/icons/image2.gif) | Kuipers, Pieter Heij..> | 2026-01-27 22:35 | 191K | |
![[IMG]](/icons/image2.gif) | Schuiringa, Jansje G..> | 2026-01-27 22:35 | 185K | |
![[IMG]](/icons/image2.gif) | Schulte, Gerardus Be..> | 2026-01-27 22:35 | 189K | |
![[IMG]](/icons/image2.gif) | Schuver, Joannes Mar..> | 2026-01-27 22:35 | 189K | |
![[IMG]](/icons/image2.gif) | Seijffardt, August L..> | 2026-01-27 22:35 | 188K | |
![[IMG]](/icons/image2.gif) | Sevensma, Tietse Pie..> | 2026-01-27 22:35 | 189K | |
![[IMG]](/icons/image2.gif) | Sierksma, Fokke 30-..> | 2026-01-27 22:35 | 191K | |
![[IMG]](/icons/image2.gif) | Siewertsz van Reesem..> | 2026-01-27 22:35 | 191K | |
![[IMG]](/icons/image2.gif) | Simons, David 3-11-1..> | 2026-01-27 22:35 | 192K | |
![[IMG]](/icons/image2.gif) | Sirks, Marius Jacob ..> | 2026-01-27 22:35 | 192K | |
![[IMG]](/icons/image2.gif) | Six, Jan 2 februari ..> | 2026-01-27 22:35 | 191K | |
![[IMG]](/icons/image2.gif) | Six, Pieter Jacob 5-..> | 2026-01-27 22:35 | 190K | |
![[IMG]](/icons/image2.gif) | Sleeswijk, Reijndert..> | 2026-01-27 22:35 | 188K | |
![[IMG]](/icons/image2.gif) | Slogteren, Egbertus ..> | 2026-01-27 22:35 | 188K | |
![[IMG]](/icons/image2.gif) | Slot, Theodorus Egbe..> | 2026-01-27 22:35 | 189K | |
![[IMG]](/icons/image2.gif) | Slotemaker de Bruïn..> | 2026-01-27 22:35 | 190K | |
![[IMG]](/icons/image2.gif) | Smallenbroek, Jan 21..> | 2026-01-27 22:35 | 192K | |
![[IMG]](/icons/image2.gif) | Smalt, Willem 19-9-1..> | 2026-01-27 22:35 | 188K | |
![[IMG]](/icons/image2.gif) | Stokman, Jacobus Ger..> | 2026-01-27 22:35 | 190K | |
![[IMG]](/icons/image2.gif) | Stork, Coenraad Fred..> | 2026-01-27 22:35 | 192K | |
![[IMG]](/icons/image2.gif) | Stork, Charles Theod..> | 2026-01-27 22:35 | 6.2M | |
![[IMG]](/icons/image2.gif) | Stotijn, Jacob Hendr..> | 2026-01-27 22:35 | 8.8M | |
![[IMG]](/icons/image2.gif) | Struiken, Antonius A..> | 2026-01-27 22:35 | 189K | |
![[IMG]](/icons/image2.gif) | Struiken, Antoon Arn..> | 2026-01-27 22:35 | 186K | |
![[IMG]](/icons/image2.gif) | Struycken, Arnoldus ..> | 2026-01-27 22:35 | 188K | |
![[IMG]](/icons/image2.gif) | Stuers, Victor Eugè..> | 2026-01-27 22:35 | 191K | |
![[IMG]](/icons/image2.gif) | Stulemeijer, Carel L..> | 2026-01-27 22:35 | 190K | |
![[IMG]](/icons/image2.gif) | Suchtelen, Nicolaas ..> | 2026-01-27 22:35 | 190K | |
![[IMG]](/icons/image2.gif) | Suijs, Joseph 5-1-1..> | 2026-01-27 22:35 | 191K | |
![[IMG]](/icons/image2.gif) | Suringa, Derkje 25 m..> | 2026-01-27 22:35 | 188K | |
![[IMG]](/icons/image2.gif) | Suurhoff, Jacobus Ge..> | 2026-01-27 22:35 | 190K | |
![[IMG]](/icons/image2.gif) | Steijn, Cornelis Ger..> | 2026-01-29 18:36 | 191K | |
![[IMG]](/icons/image2.gif) | Stein, Johannes Wilh..> | 2026-01-29 18:36 | 188K | |
![[IMG]](/icons/image2.gif) | Stein, Sophia Freder..> | 2026-01-29 18:36 | 192K | |
![[IMG]](/icons/image2.gif) | Steinmetz, Sebald Ru..> | 2026-01-29 18:36 | 189K | |
![[IMG]](/icons/image2.gif) | Speet, Paulus Adrian..> | 2026-02-02 23:09 | 192K | |
![[IMG]](/icons/image2.gif) | Spelberg, Everhard D..> | 2026-02-02 23:09 | 189K | |
![[IMG]](/icons/image2.gif) | Sprang, Alfred van ..> | 2026-02-02 23:09 | 192K | |
![[IMG]](/icons/image2.gif) | Sprenger van Eijk, J..> | 2026-02-02 23:09 | 191K | |
![[IMG]](/icons/image2.gif) | Staal, Gerard Johan ..> | 2026-02-02 23:09 | 190K | |
![[IMG]](/icons/image2.gif) | Staalman, Andries Po..> | 2026-02-02 23:09 | 189K | |
![[IMG]](/icons/image2.gif) | Staf, Cornelis 23-4-..> | 2026-02-02 23:09 | 188K | |
![[IMG]](/icons/image2.gif) | Stapel, Frederik Wil..> | 2026-02-02 23:09 | 192K | |
![[IMG]](/icons/image2.gif) | Star Busmann, Cornel..> | 2026-02-02 23:09 | 192K | |
![[IMG]](/icons/image2.gif) | Star Busmann, Eduard..> | 2026-02-02 23:09 | 192K | |
![[IMG]](/icons/image2.gif) | Staring, Adolph 2-10..> | 2026-02-02 23:09 | 190K | |
![[IMG]](/icons/image2.gif) | Steenbergen, Paul Jo..> | 2026-02-02 23:09 | 189K | |
![[IMG]](/icons/image2.gif) | Steenberghe, Maximil..> | 2026-02-02 23:09 | 191K | |
![[IMG]](/icons/image2.gif) | Stenhuis, Roelof 26..> | 2026-02-02 23:09 | 192K | |
![[IMG]](/icons/image2.gif) | Sterck, Johannes Fra..> | 2026-02-02 23:09 | 191K | |
![[IMG]](/icons/image2.gif) | Sterneberg, Ferdinan..> | 2026-02-02 23:09 | 191K | |
![[IMG]](/icons/image2.gif) | Stoffel, Jan 28-12-1..> | 2026-02-02 23:09 | 192K | |
![[IMG]](/icons/image2.gif) | Stokvis, Barend Jose..> | 2026-02-02 23:09 | 191K | |
![[IMG]](/icons/image2.gif) | Stokvis, Jozef Emanu..> | 2026-02-02 23:09 | 191K | |
![[IMG]](/icons/image2.gif) | Stolk, Cornelis Adri..> | 2026-02-02 23:09 | 184K | |
![[IMG]](/icons/image2.gif) | Stomps, Theodoor Jan..> | 2026-02-02 23:09 | 190K | |
![[IMG]](/icons/image2.gif) | Suijling, Johannes P..> | 2026-02-02 23:09 | 191K | |
![[IMG]](/icons/image2.gif) | Jager, Jacobus Hendr..> | 2026-02-06 23:05 | 185K | |
![[IMG]](/icons/image2.gif) | Spanjaard, Jaques 6..> | 2026-02-06 23:05 | 188K | |
![[IMG]](/icons/image2.gif) | Spierenburg, Dirk Pi..> | 2026-02-06 23:05 | 187K | |
![[IMG]](/icons/image2.gif) | Spit, Henricus Johan..> | 2026-02-06 23:05 | 187K | |
![[IMG]](/icons/image2.gif) | Spit, Nicolaus Barth..> | 2026-02-06 23:05 | 190K | |
![[IMG]](/icons/image2.gif) | Spitzen, Dirk Gerard..> | 2026-02-06 23:05 | 189K | |
![[IMG]](/icons/image2.gif) | Spronck, Charles Hen..> | 2026-02-06 23:05 | 192K | |
![[IMG]](/icons/image2.gif) | Tinbergen, Dirk Corn..> | 2026-02-06 23:05 | 189K | |
![[IMG]](/icons/image2.gif) | Treub, Marie Willem ..> | 2026-02-06 23:05 | 186K | |
![[IMG]](/icons/image2.gif) | Trip, Leonardus Jaco..> | 2026-02-06 23:05 | 192K | |
![[IMG]](/icons/image2.gif) | Trosée, Jacobus Ant..> | 2026-02-06 23:05 | 190K | |
![[IMG]](/icons/image2.gif) | Tulder, Lodewijk Ali..> | 2026-02-06 23:05 | 192K | |
![[IMG]](/icons/image2.gif) | Twijnstra, Tjeerd Ja..> | 2026-02-06 23:05 | 189K | |
![[IMG]](/icons/image2.gif) | Berg, Franciscus Joh..> | 2026-02-11 20:21 | 189K | |
![[IMG]](/icons/image2.gif) | Gelderen, Cornelis v..> | 2026-02-11 20:21 | 191K | |
![[IMG]](/icons/image2.gif) | Tal, Justus 10-12-1..> | 2026-02-11 20:21 | 179K | |
![[IMG]](/icons/image2.gif) | Talma, Aritius Sybra..> | 2026-02-11 20:21 | 187K | |
![[IMG]](/icons/image2.gif) | Tas, Salomon 31-8-19..> | 2026-02-11 20:21 | 188K | |
![[IMG]](/icons/image2.gif) | Tempel, Arnold Jan v..> | 2026-02-11 20:21 | 192K | |
![[IMG]](/icons/image2.gif) | Tempel, Bastiaan van..> | 2026-02-11 20:21 | 190K | |
![[IMG]](/icons/image2.gif) | Tempel, Jan van den ..> | 2026-02-11 20:21 | 192K | |
![[IMG]](/icons/image2.gif) | Tenhaeff, Nicolaas B..> | 2026-02-11 20:21 | 190K | |
![[IMG]](/icons/image2.gif) | Tesch, Johan Jacob 7..> | 2026-02-11 20:21 | 189K | |
![[IMG]](/icons/image2.gif) | Tesch, Pieter 2-1-18..> | 2026-02-11 20:21 | 191K | |
![[IMG]](/icons/image2.gif) | Tets, Dirk Arnold Wi..> | 2026-02-11 20:21 | 189K | |
![[IMG]](/icons/image2.gif) | Tetterode, Nicolaas ..> | 2026-02-11 20:21 | 189K | |
![[IMG]](/icons/image2.gif) | Thiel, Frans Joseph ..> | 2026-02-11 20:21 | 190K | |
![[IMG]](/icons/image2.gif) | Thiel, Johannes Hend..> | 2026-02-11 20:21 | 189K | |
![[IMG]](/icons/image2.gif) | Thijsse, Johannes Th..> | 2026-02-11 20:21 | 191K | |
![[IMG]](/icons/image2.gif) | Thomson, Lodewijk Wi..> | 2026-02-11 20:21 | 188K | |
![[IMG]](/icons/image2.gif) | Tilanus, Hendrik Wil..> | 2026-02-11 20:21 | 191K | |
![[IMG]](/icons/image2.gif) | Tillema, Hendrik Fre..> | 2026-02-11 20:21 | 186K | |
![[IMG]](/icons/image2.gif) | Timmerman, Aegidius ..> | 2026-02-11 20:21 | 189K | |
![[IMG]](/icons/image2.gif) | Tindal, Hendrik Piet..> | 2026-02-11 20:21 | 190K | |
![[IMG]](/icons/image2.gif) | Tjarda Van Starkenbo..> | 2026-02-11 20:21 | 180K | |
![[IMG]](/icons/image2.gif) | Taverne, Bernardus M..> | 2026-02-16 22:01 | 192K | |
![[IMG]](/icons/image2.gif) | Telders, Benjamin Ma..> | 2026-02-16 22:01 | 189K | |
![[IMG]](/icons/image2.gif) | Tepe, Wilhelm Victor..> | 2026-02-16 22:01 | 191K | |
![[IMG]](/icons/image2.gif) | Terpstra, Heert 13-1..> | 2026-02-16 22:01 | 190K | |
![[IMG]](/icons/image2.gif) | Teulings, Franciscus..> | 2026-02-16 22:01 | 190K | |
![[IMG]](/icons/image2.gif) | Unger, Willem Sybran..> | 2026-02-16 22:01 | 189K | |
![[IMG]](/icons/image2.gif) | Unnik, Willem Cornel..> | 2026-02-16 22:01 | 190K | |
![[IMG]](/icons/image2.gif) | Valkhoff, Johan 8-3-..> | 2026-02-16 22:01 | 189K | |
![[IMG]](/icons/image2.gif) | Veder, Anthony 7-10-..> | 2026-02-16 22:01 | 191K | |
![[IMG]](/icons/image2.gif) | Veder, Jan Constanti..> | 2026-02-16 22:01 | 187K | |
![[IMG]](/icons/image2.gif) | Veder, Jan Hoyte 29-..> | 2026-02-16 22:01 | 191K | |
![[IMG]](/icons/image2.gif) | Veegens, Jacob Dirk ..> | 2026-02-16 22:01 | 189K | |
![[IMG]](/icons/image2.gif) | Vries, François de ..> | 2026-02-16 22:01 | 186K | |
![[IMG]](/icons/image2.gif) | Vries, Hessel de 15-..> | 2026-02-16 22:01 | 191K | |
![[IMG]](/icons/image2.gif) | Vries, Jan Pieter Ma..> | 2026-02-16 22:01 | 188K | |
![[IMG]](/icons/image2.gif) | Vries, Simon Philip ..> | 2026-02-16 22:01 | 189K | |
![[IMG]](/icons/image2.gif) | Vroom, Wilhelmus Her..> | 2026-02-16 22:01 | 187K | |
![[IMG]](/icons/image2.gif) | Snijders, Jan Anthon..> | 2026-02-19 22:36 | 187K | |
![[IMG]](/icons/image2.gif) | Veen, Henri Nicolaas..> | 2026-02-19 22:36 | 192K | |
![[IMG]](/icons/image2.gif) | Vogt, Willem 12-8-18..> | 2026-02-19 22:36 | 189K | |
![[IMG]](/icons/image2.gif) | Vollenhoven, Corneli..> | 2026-02-19 22:36 | 186K | |
![[IMG]](/icons/image2.gif) | Vollenhoven, Dirk He..> | 2026-02-19 22:36 | 250K | |
![[IMG]](/icons/image2.gif) | Vollgraff, Johan Adr..> | 2026-02-19 22:36 | 190K | |
![[IMG]](/icons/image2.gif) | Vondeling, Anne 02-0..> | 2026-02-19 22:36 | 184K | |
![[IMG]](/icons/image2.gif) | Voormolen, Alexander..> | 2026-02-19 22:36 | 189K | |
![[IMG]](/icons/image2.gif) | Vorm, Willem van der..> | 2026-02-19 22:36 | 192K | |
![[IMG]](/icons/image2.gif) | Vorm, William Nicola..> | 2026-02-19 22:36 | 192K | |
![[IMG]](/icons/image2.gif) | Vorsterman van Oijen..> | 2026-02-19 22:36 | 190K | |
![[IMG]](/icons/image2.gif) | Vos, Hendrik 5-7-19..> | 2026-02-19 22:36 | 188K | |
![[IMG]](/icons/image2.gif) | Vos, Jan Cornelis de..> | 2026-02-19 22:36 | 192K | |
![[IMG]](/icons/image2.gif) | Voûte, Edward John ..> | 2026-02-19 22:36 | 191K | |
![[IMG]](/icons/image2.gif) | Vries, Carl Wilhelm ..> | 2026-02-19 22:36 | 191K | |
![[IMG]](/icons/image2.gif) | Vries, Arend de 6-1..> | 2026-02-19 22:36 | 190K | |
![[IMG]](/icons/image2.gif) | Vries, Salomon de 11..> | 2026-02-19 22:36 | 187K | |
![[IMG]](/icons/image2.gif) | Vries, Simon de 9-1-..> | 2026-02-19 22:36 | 190K | |
![[IMG]](/icons/image2.gif) | Vrij, Maarten Pleun ..> | 2026-02-19 22:36 | 191K | |
![[IMG]](/icons/image2.gif) | Verberne, Louis Gera..> | 2026-02-20 02:13 | 190K | |
![[IMG]](/icons/image2.gif) | Vorsterman van Oijen..> | 2026-02-20 02:13 | 187K | |
![[IMG]](/icons/image2.gif) | Vincent, Jacob 4-12-..> | 2026-02-23 21:57 | 189K | |
![[IMG]](/icons/image2.gif) | Virulij, Adriaan 5-1..> | 2026-02-23 21:57 | 189K | |
![[IMG]](/icons/image2.gif) | Visscher, Hugo 12-1..> | 2026-02-23 21:57 | 190K | |
![[IMG]](/icons/image2.gif) | Visser Johannes Theo..> | 2026-02-23 21:57 | 189K | |
![[IMG]](/icons/image2.gif) | Visser, Albert 14 fe..> | 2026-02-23 21:57 | 255K | |
![[IMG]](/icons/image2.gif) | Visser, Louis Leonar..> | 2026-02-23 21:57 | 190K | |
![[IMG]](/icons/image2.gif) | Visser, Philips Chri..> | 2026-02-23 21:57 | 190K | |
![[IMG]](/icons/image2.gif) | Visser, Simon Hendri..> | 2026-02-23 21:57 | 191K | |
![[IMG]](/icons/image2.gif) | Vissering, Gerard 1-..> | 2026-02-23 21:57 | 187K | |
![[IMG]](/icons/image2.gif) | Vlekke, Bernardus Hu..> | 2026-02-23 21:57 | 192K | |
![[IMG]](/icons/image2.gif) | Vliegen, Wilhelmus H..> | 2026-02-23 21:57 | 184K | |
![[IMG]](/icons/image2.gif) | Vlugt, Willem van de..> | 2026-02-23 21:57 | 189K | |
![[IMG]](/icons/image2.gif) | Verschuur, Timotheus..> | 2026-02-24 21:43 | 191K | |
![[IMG]](/icons/image2.gif) | Verviers, Emile Gera..> | 2026-02-24 21:43 | 192K | |
![[IMG]](/icons/image2.gif) | Vet, Gerardus Henric..> | 2026-02-24 21:43 | 189K | |
![[IMG]](/icons/image2.gif) | Vinke, Willem 22-3-1..> | 2026-02-24 21:43 | 191K | |
![[IMG]](/icons/image2.gif) | Viotta, Henricus Ana..> | 2026-02-24 21:43 | 190K | |
![[IMG]](/icons/image2.gif) | Verboom, Jan 4-2-189..> | 2026-02-27 00:34 | 189K | |
![[IMG]](/icons/image2.gif) | Verdam, Jacob 22 ja..> | 2026-02-27 00:34 | 190K | |
![[IMG]](/icons/image2.gif) | Verdam, Jan 17-7-18..> | 2026-02-27 00:34 | 191K | |
![[IMG]](/icons/image2.gif) | Verkade, Eduard Rutg..> | 2026-02-27 00:34 | 190K | |
![[IMG]](/icons/image2.gif) | Vermaseren, Bernard ..> | 2026-02-27 00:34 | 189K | |
![[IMG]](/icons/image2.gif) | Verrijn Stuart, Coen..> | 2026-02-27 00:34 | 191K | |
![[IMG]](/icons/image2.gif) | Verrijn Stuart, Gera..> | 2026-02-27 00:34 | 187K | |
![[IMG]](/icons/image2.gif) | Verweij, Evert Johan..> | 2026-02-27 00:34 | 192K | |
![[IMG]](/icons/image2.gif) | Verzijl, Jan Hendrik..> | 2026-02-27 00:34 | 190K | |
![[IMG]](/icons/image2.gif) | Vierssen Trip, Gusta..> | 2026-02-27 00:34 | 192K | |
![[IMG]](/icons/image2.gif) | Dienske, Hendrik 30 ..> | 2026-03-03 01:00 | 190K | |
![[IMG]](/icons/image2.gif) | Jansen, Willem Piete..> | 2026-03-03 01:00 | 190K | |
![[IMG]](/icons/image2.gif) | Ravens, Laurens van ..> | 2026-03-03 01:00 | 190K | |
![[IMG]](/icons/image2.gif) | Sanders, Pieter 21 s..> | 2026-03-03 01:00 | 191K | |
![[IMG]](/icons/image2.gif) | Tuijn, Cornelis van ..> | 2026-03-03 01:00 | 189K | |
![[IMG]](/icons/image2.gif) | Veer, Paul van 't 16..> | 2026-03-03 01:00 | 190K | |
![[IMG]](/icons/image2.gif) | Vegting, Wilhelmus G..> | 2026-03-03 01:00 | 190K | |
![[IMG]](/icons/image2.gif) | Veld, Joris in 't 5-..> | 2026-03-03 01:00 | 189K | |
![[IMG]](/icons/image2.gif) | Veldkamp, Gerardus M..> | 2026-03-03 01:00 | 190K | |
![[IMG]](/icons/image2.gif) | Veraart, Joannes Ant..> | 2026-03-03 01:00 | 185K | |
![[IMG]](/icons/image2.gif) | Verdoorn, Petrus Joh..> | 2026-03-03 01:00 | 191K | |
![[IMG]](/icons/image2.gif) | Woerkom, Johannes Ja..> | 2026-03-03 01:00 | 190K | |
![[IMG]](/icons/image2.gif) | Zoetmulder, Adriaan ..> | 2026-03-03 01:00 | 190K | |
![[IMG]](/icons/image2.gif) | Beij, Maria 5 augus..> | 2026-03-08 18:13 | 189K | |
![[IMG]](/icons/image2.gif) | Colsen, Honoré Jose..> | 2026-03-08 18:13 | 189K | |
![[IMG]](/icons/image2.gif) | Dis, Cornelis Nicola..> | 2026-03-08 18:13 | 185K | |
![[IMG]](/icons/image2.gif) | Kolkman, Joseph Will..> | 2026-03-08 18:13 | 185K | |
![[IMG]](/icons/image2.gif) | Noach, Salomon Jacob..> | 2026-03-08 18:13 | 190K | |
![[IMG]](/icons/image2.gif) | Veenendaal, Augustus..> | 2026-03-08 18:13 | 191K | |
![[IMG]](/icons/image2.gif) | Veenendaal, Willem C..> | 2026-03-08 18:13 | 191K | |
![[IMG]](/icons/image2.gif) | Veenhuizen, Geert 18..> | 2026-03-08 18:13 | 187K | |
![[IMG]](/icons/image2.gif) | Zandt, Pieter 6-3-18..> | 2026-03-08 18:13 | 185K | |
![[IMG]](/icons/image2.gif) | Zandvoort, Reinard W..> | 2026-03-08 18:13 | 186K | |
![[IMG]](/icons/image2.gif) | Zentgraaff, Henri Ca..> | 2026-03-08 18:13 | 187K | |
![[IMG]](/icons/image2.gif) | Zevenbergen, Christi..> | 2026-03-08 18:13 | 188K | |
![[IMG]](/icons/image2.gif) | Zijl, Lambertus 13-6..> | 2026-03-08 18:13 | 187K | |
![[IMG]](/icons/image2.gif) | Zimmerman, Alfred Ru..> | 2026-03-08 18:13 | 187K | |
![[IMG]](/icons/image2.gif) | Zocher, Louis Paul 1..> | 2026-03-08 18:13 | 187K | |
![[IMG]](/icons/image2.gif) | Zuure, Bernardus Mau..> | 2026-03-08 18:13 | 191K | |
![[IMG]](/icons/image2.gif) | Zwaag, Geert van der..> | 2026-03-08 18:13 | 190K | |
![[IMG]](/icons/image2.gif) | Zwart, Jan 20-8-187..> | 2026-03-08 18:13 | 192K | |
![[IMG]](/icons/image2.gif) | Zwartkruis, Theodoru..> | 2026-03-08 18:13 | 189K | |
![[IMG]](/icons/image2.gif) | IJsselmuiden, Joseph..> | 2026-03-11 21:53 | 177K | |
![[IMG]](/icons/image2.gif) | IJsselsteijn, Hendri..> | 2026-03-11 21:53 | 190K | |
![[IMG]](/icons/image2.gif) | IJzerman, Jan Willem..> | 2026-03-11 21:53 | 191K | |
![[IMG]](/icons/image2.gif) | Waal Malefijt, Jan H..> | 2026-03-11 21:53 | 190K | |
![[IMG]](/icons/image2.gif) | Waard, Cornelis de 1..> | 2026-03-11 21:53 | 190K | |
![[IMG]](/icons/image2.gif) | Waart, Cornelis Kare..> | 2026-03-11 21:53 | 192K | |
![[IMG]](/icons/image2.gif) | Winter, Pieter Jan v..> | 2026-03-11 21:53 | 189K | |
![[IMG]](/icons/image2.gif) | Wisselink, Jan 17-4-..> | 2026-03-11 21:53 | 190K | |
![[IMG]](/icons/image2.gif) | Witlox, Johannes Hen..> | 2026-03-11 21:53 | 189K | |
![[IMG]](/icons/image2.gif) | Witte, Herman Bernar..> | 2026-03-11 21:53 | 189K | |
![[IMG]](/icons/image2.gif) | Wittert van Hoogland..> | 2026-03-11 21:53 | 191K | |
![[IMG]](/icons/image2.gif) | Woldringh, Meinardus..> | 2026-03-11 21:53 | 189K | |
![[IMG]](/icons/image2.gif) | Wolf, Hendrik de 21..> | 2026-03-11 21:53 | 189K | |
![[IMG]](/icons/image2.gif) | Wolff, Salomon de 13..> | 2026-03-11 21:53 | 186K | |
![[IMG]](/icons/image2.gif) | Wolterbeek Muller, D..> | 2026-03-11 21:53 | 189K | |
![[IMG]](/icons/image2.gif) | Woltersom, Herman Lo..> | 2026-03-11 21:53 | 186K | |
![[IMG]](/icons/image2.gif) | Worp, Jacob Adolf 21..> | 2026-03-11 21:53 | 192K | |
![[IMG]](/icons/image2.gif) | Woudenberg, Hendrik ..> | 2026-03-11 21:53 | 192K | |
![[IMG]](/icons/image2.gif) | Wumkes, Geert Aeilco..> | 2026-03-11 21:53 | 191K | |
![[IMG]](/icons/image2.gif) | Zandleven, Jan Adam ..> | 2026-03-11 21:53 | 191K | |
![[IMG]](/icons/image2.gif) | Wijnveldt, Jan 31-5..> | 2026-03-12 20:50 | 184K | |
![[IMG]](/icons/image2.gif) | Wilde, Jacob Adriaan..> | 2026-03-12 20:50 | 190K | |
![[IMG]](/icons/image2.gif) | Wilson, Johannes Jac..> | 2026-03-12 20:50 | 192K | |
![[IMG]](/icons/image2.gif) | Wilton, Bartel 26-4-..> | 2026-03-12 20:50 | 188K | |
![[IMG]](/icons/image2.gif) | Wilton, John Henry 1..> | 2026-03-12 20:50 | 188K | |
![[IMG]](/icons/image2.gif) | Wind, Cornelis Harm ..> | 2026-03-12 20:50 | 192K | |
![[IMG]](/icons/image2.gif) | Wijn, Jan Willem 20-..> | 2026-03-13 16:52 | 189K | |
![[IMG]](/icons/image2.gif) | Wijnberg, Abraham 26..> | 2026-03-13 16:52 | 190K | |
![[IMG]](/icons/image2.gif) | Wijnbergen, Antonius..> | 2026-03-13 16:52 | 188K | |
![[IMG]](/icons/image2.gif) | Willekens, Peter Joh..> | 2026-03-13 16:52 | 189K | |
![[IMG]](/icons/image2.gif) | Frank, Maria Carolin..> | 2026-03-17 19:50 | 190K | |
![[IMG]](/icons/image2.gif) | Junius, Francisca Jo..> | 2026-03-17 19:50 | 187K | |
![[IMG]](/icons/image2.gif) | Liefsting, Focco Ber..> | 2026-03-17 19:50 | 189K | |
![[IMG]](/icons/image2.gif) | Wadman, Anne Sybe 30..> | 2026-03-17 19:50 | 190K | |
![[IMG]](/icons/image2.gif) | Waller, François Ge..> | 2026-03-17 19:50 | 188K | |
![[IMG]](/icons/image2.gif) | Waller, François GÃ..> | 2026-03-17 19:50 | 192K | |
![[IMG]](/icons/image2.gif) | Walree, Emile David ..> | 2026-03-17 19:50 | 188K | |
![[IMG]](/icons/image2.gif) | Wals, Cornelis Dirk ..> | 2026-03-17 19:50 | 187K | |
![[IMG]](/icons/image2.gif) | Walsum, Gerard Ewout..> | 2026-03-17 19:50 | 191K | |
![[IMG]](/icons/image2.gif) | Waterschoot van der ..> | 2026-03-17 19:50 | 191K | |
![[IMG]](/icons/image2.gif) | Warnsinck, Johan Car..> | 2026-03-17 19:50 | 190K | |
![[IMG]](/icons/image2.gif) | Weede, Willem Marcus..> | 2026-03-17 19:50 | 191K | |
![[IMG]](/icons/image2.gif) | Weersma, Melle 22-1-..> | 2026-03-17 19:50 | 191K | |
![[IMG]](/icons/image2.gif) | Weiland, Johannes 23..> | 2026-03-17 19:50 | 187K | |
![[IMG]](/icons/image2.gif) | Weitzel, August Wilh..> | 2026-03-17 19:50 | 191K | |
![[IMG]](/icons/image2.gif) | Welter, Charles Jose..> | 2026-03-17 19:50 | 187K | |
![[IMG]](/icons/image2.gif) | Wentholt, Ludolph Re..> | 2026-03-17 19:50 | 190K | |
![[IMG]](/icons/image2.gif) | Wermeskerken, Abraha..> | 2026-03-17 19:50 | 189K | |
![[IMG]](/icons/image2.gif) | Wermeskerken, Johan ..> | 2026-03-17 19:50 | 191K | |
![[IMG]](/icons/image2.gif) | Wertheim Salomonson,..> | 2026-03-17 19:50 | 188K | |
![[IMG]](/icons/image2.gif) | Westenbrink, Hendrik..> | 2026-03-17 19:50 | 189K | |
![[IMG]](/icons/image2.gif) | Westerman, Willem 14..> | 2026-03-17 19:50 | 190K | |
![[IMG]](/icons/image2.gif) | Westerouen Van Meete..> | 2026-03-17 19:50 | 190K | |
![[IMG]](/icons/image2.gif) | Wetering, Hendrik va..> | 2026-03-17 19:50 | 188K | |
![[IMG]](/icons/image2.gif) | Wezelaar, Henri Matt..> | 2026-03-17 19:50 | 190K | |
![[IMG]](/icons/image2.gif) | Wichers, Hendrikus O..> | 2026-03-17 19:50 | 183K | |
![[IMG]](/icons/image2.gif) | Wielen, Hendrik Gera..> | 2026-03-17 19:50 | 189K | |
![[IMG]](/icons/image2.gif) | Wijers, Theodorus Re..> | 2026-03-17 19:50 | 190K | |
![[IMG]](/icons/image2.gif) | Wijffels, Franciscus..> | 2026-03-17 19:50 | 192K | |
![[IMG]](/icons/image2.gif) | Waijenburg, Alexande..> | 2026-03-18 16:28 | 190K | |
![[IMG]](/icons/image2.gif) | Waller Zeper, Sijbra..> | 2026-03-18 16:28 | 191K | |
![[IMG]](/icons/image2.gif) | Waller, François Ge..> | 2026-03-18 16:28 | 192K | |
![[IMG]](/icons/image2.gif) | Berg, Steven Gerrit ..> | 2026-03-22 15:10 | 191K | |
![[IMG]](/icons/image2.gif) | Dijker, Jan 19 novem..> | 2026-03-22 15:10 | 191K | |
![[IMG]](/icons/image2.gif) | Flaes, Reijnier (FC ..> | 2026-03-22 15:10 | 192K | |
![[IMG]](/icons/image2.gif) | Putman Cramer, Piete..> | 2026-03-22 15:10 | 191K | |
![[IMG]](/icons/image2.gif) | Tegelberg, Petrus Em..> | 2026-03-22 15:10 | 188K | |
![[IMG]](/icons/image2.gif) | Tetterode, Leendert ..> | 2026-03-22 15:10 | 191K | |
![[IMG]](/icons/image2.gif) | Timman, Reinier 6 me..> | 2026-03-22 15:10 | 192K | |
![[IMG]](/icons/image2.gif) | Timmner, Christiaan ..> | 2026-03-22 15:10 | 190K | |
![[IMG]](/icons/image2.gif) | Dijk, Anna van 24 de..> | 2026-03-23 21:41 | 191K | |
![[IMG]](/icons/image2.gif) | Isings, Johan Herman..> | 2026-03-23 21:41 | 192K | |
![[IMG]](/icons/image2.gif) | Jansen, Marinus (en ..> | 2026-03-23 21:41 | 191K | |
![[IMG]](/icons/image2.gif) | Jorink, Gerritdina H..> | 2026-03-23 21:41 | 191K | |
![[IMG]](/icons/image2.gif) | Lennep, Johanna Elis..> | 2026-03-23 21:41 | 191K | |
![[IMG]](/icons/image2.gif) | Meijer, Willem 6 jan..> | 2026-03-23 21:41 | 191K | |
![[IMG]](/icons/image2.gif) | Nobach, Pier 11 sept..> | 2026-03-23 21:41 | 190K | |
![[IMG]](/icons/image2.gif) | Philippa, Jacobus Pe..> | 2026-03-23 21:41 | 189K | |
![[IMG]](/icons/image2.gif) | Simons, Branca 28-4-..> | 2026-03-23 21:41 | 189K | |
![[IMG]](/icons/image2.gif) | Sleijfer, Zacharias ..> | 2026-03-23 21:41 | 192K | |
![[IMG]](/icons/image2.gif) | Sligte, Gerrit 20 au..> | 2026-03-23 21:41 | 190K | |
![[IMG]](/icons/image2.gif) | Smit, Christiaan 6 j..> | 2026-03-23 21:41 | 188K | |
![[IMG]](/icons/image2.gif) | Bernelot Moens, Herm..> | 2026-03-25 19:05 | 189K | |
![[IMG]](/icons/image2.gif) | Koopman, Christoffel..> | 2026-03-25 19:05 | 191K | |
![[IMG]](/icons/image2.gif) | Kuiper, Adrianus IJs..> | 2026-03-25 19:05 | 189K | |
![[IMG]](/icons/image2.gif) | Metz, Alexander 14 j..> | 2026-03-25 19:05 | 192K | |
![[IMG]](/icons/image2.gif) | Mink, Antoon Berend ..> | 2026-03-25 19:05 | 192K | |
![[IMG]](/icons/image2.gif) | Morssink, Franciscus..> | 2026-03-25 19:05 | 190K | |
![[IMG]](/icons/image2.gif) | Oorschot, Johan Will..> | 2026-03-25 19:05 | 188K | |
![[IMG]](/icons/image2.gif) | Oudshoorn, Albert Ja..> | 2026-03-25 19:05 | 189K | |
![[IMG]](/icons/image2.gif) | Plantenga, Broer Pie..> | 2026-03-25 19:05 | 188K | |
![[IMG]](/icons/image2.gif) | Ruijsch, Aletta Jaco..> | 2026-03-25 19:05 | 190K | |
![[IMG]](/icons/image2.gif) | Schoorl, Hendrik 1 f..> | 2026-03-25 19:05 | 188K | |
![[IMG]](/icons/image2.gif) | Seyffardt, August Lo..> | 2026-03-25 19:05 | 185K | |
![[IMG]](/icons/image2.gif) | Simon, Joannes Bapti..> | 2026-03-25 19:05 | 189K | |
![[IMG]](/icons/image2.gif) | Ankersmit, Gerharda ..> | 2026-03-29 23:29 | 188K | |
![[IMG]](/icons/image2.gif) | Asselt, Gerda Freder..> | 2026-03-29 23:29 | 192K | |
![[IMG]](/icons/image2.gif) | Auwerda, Ettina Gerh..> | 2026-03-29 23:29 | 188K | |
![[IMG]](/icons/image2.gif) | Boon, Klaas Willem 1..> | 2026-03-29 23:29 | 190K | |
![[IMG]](/icons/image2.gif) | Breet, Cornelis 27 o..> | 2026-03-29 23:29 | 188K | |
![[IMG]](/icons/image2.gif) | Cachet, Carel Adolph..> | 2026-03-29 23:29 | 191K | |
![[IMG]](/icons/image2.gif) | Fock, Cornelis Laure..> | 2026-03-29 23:29 | 188K | |
![[IMG]](/icons/image2.gif) | Franken, Tjebbo Gera..> | 2026-03-29 23:29 | 192K | |
![[IMG]](/icons/image2.gif) | Frankevoort, Johanne..> | 2026-03-29 23:29 | 192K | |
![[IMG]](/icons/image2.gif) | Geen, François Mari..> | 2026-03-29 23:29 | 192K | |
![[IMG]](/icons/image2.gif) | Geen, Jan Alexander ..> | 2026-03-29 23:29 | 189K | |
![[IMG]](/icons/image2.gif) | Graaff, Coenraad Nic..> | 2026-03-29 23:29 | 191K | |
![[IMG]](/icons/image2.gif) | Guépin, Anthonij Jo..> | 2026-03-29 23:29 | 190K | |
![[IMG]](/icons/image2.gif) | Hollestelle, David 1..> | 2026-03-29 23:29 | 190K | |
![[IMG]](/icons/image2.gif) | Hoogenbosch, Johanne..> | 2026-03-29 23:29 | 191K | |
![[IMG]](/icons/image2.gif) | Joncheere, Gerardus ..> | 2026-03-29 23:29 | 191K | |
![[IMG]](/icons/image2.gif) | Jonker, Wilhelm 26 n..> | 2026-03-29 23:29 | 187K | |
![[IMG]](/icons/image2.gif) | Jongsma, Jacob Lucas..> | 2026-03-29 23:29 | 188K | |
![[IMG]](/icons/image2.gif) | Kamerlingh Onnes, Me..> | 2026-03-29 23:29 | 188K | |
![[IMG]](/icons/image2.gif) | Leijer, Anna Clasina..> | 2026-03-29 23:29 | 191K | |
![[IMG]](/icons/image2.gif) | Polak, Jimmy Maurice..> | 2026-03-29 23:29 | 189K | |
![[IMG]](/icons/image2.gif) | Verstegen, Frederik ..> | 2026-03-29 23:29 | 191K | |
![[IMG]](/icons/image2.gif) | Vries, Alida Elisabe..> | 2026-03-29 23:29 | 188K | |
![[IMG]](/icons/image2.gif) | Vroome, Pieter Corne..> | 2026-03-29 23:29 | 190K | |
![[IMG]](/icons/image2.gif) | Wessels Boer, Nicola..> | 2026-03-29 23:29 | 189K | |
![[IMG]](/icons/image2.gif) | Wijs, Willem Joseph ..> | 2026-03-29 23:29 | 190K | |
![[IMG]](/icons/image2.gif) | Wijvekate, Maren Leo..> | 2026-03-29 23:29 | 192K | |
![[IMG]](/icons/image2.gif) | Ablaing van Giessenb..> | 2026-04-02 22:42 | 189K | |
![[IMG]](/icons/image2.gif) | Andel, Geertruida An..> | 2026-04-02 22:42 | 190K | |
![[IMG]](/icons/image2.gif) | Ankersmit, Johan Fre..> | 2026-04-02 22:42 | 192K | |
![[IMG]](/icons/image2.gif) | Ansing, Willem op 3 ..> | 2026-04-02 22:42 | 191K | |
![[IMG]](/icons/image2.gif) | Arbeid, Isaäc op 15..> | 2026-04-02 22:42 | 189K | |
![[IMG]](/icons/image2.gif) | Brouwer, Hendrik 12 ..> | 2026-04-02 22:42 | 189K | |
![[IMG]](/icons/image2.gif) | Verster van Wulverho..> | 2026-04-02 22:42 | 186K | |
![[IMG]](/icons/image2.gif) | Boshart, Maurits 28 ..> | 2026-04-03 16:56 | 192K | |
![[IMG]](/icons/image2.gif) | Bosman, Fokke 22 nov..> | 2026-04-03 16:56 | 192K | |
![[IMG]](/icons/image2.gif) | Bot, Lambertus Johan..> | 2026-04-03 16:56 | 191K | |
![[IMG]](/icons/image2.gif) | Bouwman, Engelbertus..> | 2026-04-03 16:56 | 189K | |
![[IMG]](/icons/image2.gif) | Bouwmeester, Maria C..> | 2026-04-03 16:56 | 188K | |
![[IMG]](/icons/image2.gif) | Bruens, Hendrikus Jo..> | 2026-04-03 16:56 | 184K | |
![[IMG]](/icons/image2.gif) | Bruins, Angenita Eng..> | 2026-04-03 16:56 | 188K | |
![[IMG]](/icons/image2.gif) | Burink, Gerrit van 1..> | 2026-04-03 16:56 | 187K | |
![[IMG]](/icons/image2.gif) | Bymholt, Berend 9 ju..> | 2026-04-03 16:56 | 192K | |
![[IMG]](/icons/image2.gif) | Klompé, Margaretha ..> | 2026-04-03 16:56 | 186K | |
![[IMG]](/icons/image2.gif) | Vries, Nathan Albert..> | 2026-04-03 16:56 | 187K | |
![[IMG]](/icons/image2.gif) | Boekhorst, Johannes ..> | 2026-04-06 21:16 | 188K | |
![[IMG]](/icons/image2.gif) | Boer, Harmen de 30 j..> | 2026-04-06 21:16 | 192K | |
![[IMG]](/icons/image2.gif) | Boers, Benjamin 25 s..> | 2026-04-06 21:16 | 187K | |
![[IMG]](/icons/image2.gif) | Bokkel, Jan Gerhard ..> | 2026-04-06 21:16 | 185K | |
![[IMG]](/icons/image2.gif) | Born, Jacoba Hendrik..> | 2026-04-06 21:16 | 192K | |
![[IMG]](/icons/image2.gif) | Borsje, Maarten 3 ma..> | 2026-04-06 21:16 | 189K | |
![[IMG]](/icons/image2.gif) | Bos, Karel Antonie 1..> | 2026-04-06 21:16 | 190K | |
![[IMG]](/icons/image2.gif) | Braambeek, Hendrik J..> | 2026-04-06 21:16 | 192K | |
![[IMG]](/icons/image2.gif) | Brader Bzn., Eelko 1..> | 2026-04-06 21:16 | 190K | |
![[IMG]](/icons/image2.gif) | Brandsteder, Jacob A..> | 2026-04-06 21:16 | 188K | |
![[IMG]](/icons/image2.gif) | Brautigam, Johan 18 ..> | 2026-04-06 21:16 | 189K | |
![[IMG]](/icons/image2.gif) | Brink, Johannes Anto..> | 2026-04-06 21:16 | 190K | |
![[IMG]](/icons/image2.gif) | Brinkhuis, Johannes ..> | 2026-04-06 21:16 | 192K | |
![[IMG]](/icons/image2.gif) | Brok, Klaas 15 novem..> | 2026-04-06 21:16 | 189K | |
![[IMG]](/icons/image2.gif) | Brommert, Johannes 2..> | 2026-04-06 21:16 | 189K | |
![[IMG]](/icons/image2.gif) | Bruijn, Jacob Leende..> | 2026-04-06 21:16 | 190K | |
![[IMG]](/icons/image2.gif) | Bruin, Pieter de 16 ..> | 2026-04-06 21:16 | 189K | |
![[IMG]](/icons/image2.gif) | Bruins Jr., Jan Anto..> | 2026-04-06 21:16 | 189K | |
![[IMG]](/icons/image2.gif) | Bult, Franciscus Xav..> | 2026-04-06 21:16 | 5.4M | |
![[IMG]](/icons/image2.gif) | Engelbert van Beverv..> | 2026-04-06 21:16 | 192K | |
|